01904 488599
1-(Methylamino)Anthraquinone, 98%
From £58.32 per (ex VAT)
1-(Methylamino)Anthraquinone, 98%
| Product Code | M28200-100G |
|---|---|
| Unit of Measure | 1X100GR |
| CAS Number | 82-38-2 |
| MDL NUMBER | MFCD00001197 |
| EMPIRICAL FORMULA | C15H11NO2 |
| Molecular Weight | 237.25 |
| Brand | SIGMA-ALDRICH |
Tiered Pricing - M28200-100G
| Qty | Discount | Price |
|---|---|---|
| 4+ | 18% | £66.42 |
| 12+ | 20% | £64.80 |
| 36+ | 22% | £63.18 |
| 72+ | 28% | £58.32 |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12171500 |
| ADRSuff | 1 |
| CAS Number | 82-38-2 |
| Storage Temperature | room temp |
| EINECSNo | 201-417-2 |
| Flash Point | Not applicable |
| GHS Categories | Skin Irrit. 2,Eye Irrit. 2,STOT SE 3 |
| GHS Hazard Codes | H315-H319-H335 |
| GHS Hazard Statements | Causes skin irritation. Causes serious eye irritation. May cause respiratory irritation. |
| GHS Pictograms | GHS07 |
| GHS Precaution Codes | P261 - P305 + P351 + P338 |
| GHS Precaution Statements | Avoid breathing dust/ fume/ gas/ mist/ vapours/ spray. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. |
| GHS Signal Words | Warning |
| Hazard Symbols | Xi |
| Hazard Symbols Descriptions | Irritant |
| MDL Number | MFCD00001197 |
| Melting Point | 170-172 C (lit.) |
| Molecular Formula | C15H11NO2 |
| Molecular Weight | 237.25 |
| Net Weight | 100 |
| Purity Grade | 0.98 |
| R-Phrases | 36/37/38 |
| RTECSNo | CB0536600 |
| S-Phrases | 26-37/39 |
| Tariff Number | 29223900900 |
| form | powder or crystals |
| storage temp. | room temp |
| Application(s) | diagnostic assay manufacturinghematologyhistology |
| SMILES string | CNc1cccc2C(=O)c3ccccc3C(=O)c12 |
| Quality Level | 100 |
| mp | 170-172 C (lit.) |
| InChI | 1S/C15H11NO2/c1-16-12-8-4-7-11-13(12)15(18)10-6-3-2-5-9(10)14(11)17/h2-8,16H,1H3 |
| InChI key | SVTDYSXXLJYUTM-UHFFFAOYSA-N |
| Assay | 98% |
Description
1-(Methylamino)Anthraquinone, 98%