01904 488599
(1R,2S,5R)-(-)-Menthol, Reagentplus(R),
From £53.42 per (ex VAT)
(1R,2S,5R)-(-)-Menthol, Reagentplus(R),
| Product Code | M2780-100G-A |
|---|---|
| Unit of Measure | 1X100GR |
| CAS Number | 2216-51-5 |
| MDL NUMBER | MFCD00062979 |
| EMPIRICAL FORMULA | CH2O |
| Molecular Weight | 156.27 |
| Synonyms | (-)-Menthol; (1R,2S,5R)-2-Isopropyl-5-Methylcyclohexanol; 5-Methyl-2-(1-Methylethyl)Cyclohexanol |
| Brand | SIGMA-ALDRICH |
Tiered Pricing - M2780-100G-A
| Qty | Discount | Price |
|---|---|---|
| 4+ | 8% | £55.84 |
| 12+ | 10% | £54.63 |
| 36+ | 12% | £53.42 |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12352200 |
| ADRSuff | 1 |
| CAS Number | 2216-51-5 |
| Boiling Point | 212 C (lit.) |
| Density | 0.89 g/mL at 25 C (lit.) |
| EINECSNo | 218-690-9 |
| Flash Point | 94 C - closed cup |
| GHS Categories | Skin Irrit. 2 |
| GHS Hazard Codes | H315 |
| GHS Hazard Statements | Causes skin irritation. |
| GHS Pictograms | GHS07 |
| GHS Precaution Codes | - |
| GHS Precaution Statements | Avoid breathing dust/ fume/ gas/ mist/ vapours/ spray. Wear protective gloves/ eye protection/ face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. |
| GHS Signal Words | Warning |
| Hazard Symbols | Xi |
| Hazard Symbols Descriptions | Irritant |
| MDL Number | MFCD00062979 |
| Melting Point | 41-45 C (lit.) |
| Molecular Formula | CH2O |
| Molecular Weight | 156.27 |
| Net Weight | 100 |
| R-Phrases | 37/38-41 |
| S-Phrases | 26-39 |
| Synonyms | (-)-Menthol; (1R,2S,5R)-2-Isopropyl-5-methylcyclohexanol; 5-Methyl-2-(1-methylethyl)cyclohexanol |
| Tariff Number | 29061100000 |
| Quality Level | 200 |
| Assay | >=97% (HPLC) |
| SMILES string | [Na].CNc1ncnc2n(cnc12)C3OC(COP(O)(O)=O)C(O)C3O |
| storage temp. | -20C |
| biological source | synthetic (organic) |
| vapor pressure | 0.8 mmHg ( 20 C) |
| mp | 41-45 C (lit.) |
| optical activity | [alpha]20/D -50, c = 10 in ethanol |
| product line | ReagentPlus(R) |
| InChI key | NOOLISFMXDJSKH-KXUCPTDWSA-N |
| InChI | 1S/C10H20O/c1-7(2)9-5-4-8(3)6-10(9)11/h7-11H,4-6H2,1-3H3/t8-,9+,10-/m1/s1 |
| bp | 212 C (lit.) |
| solubility | water: 20 mg/mL, clear, colorless |
| optical purity | ee: 99% (GLC) |
Description
(1R,2S,5R)-(-)-Menthol, Reagentplus(R),