01904 488599
3-Aminobenzoic Acid Ethyl Ester
From £367.01 per (ex VAT)
3-Aminobenzoic Acid Ethyl Ester
| Product Code | A5040-100G |
|---|---|
| Unit of Measure | 1X100GR |
| CAS Number | 886-86-2 |
| MDL NUMBER | MFCD00013176 |
| EMPIRICAL FORMULA | C9H11NO2 |
| Molecular Weight | 261.29 |
| Synonyms | Ms-222; Tricaine |
| Brand | SUPELCO |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 41116107 |
| ADRSuff | 1 |
| CAS Number | 886-86-2 |
| EINECSNo | 212-956-8 |
| Flash Point | Not applicable |
| GHS Categories | Skin Irrit. 2,Eye Irrit. 2,STOT SE 3 |
| GHS Hazard Codes | H315-H319-H335 |
| GHS Hazard Statements | Causes skin irritation. Causes serious eye irritation. May cause respiratory irritation. |
| GHS Pictograms | GHS07 |
| GHS Precaution Codes | P261 - P305 + P351 + P338 |
| GHS Precaution Statements | Avoid breathing dust/ fume/ gas/ mist/ vapours/ spray. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. |
| GHS Signal Words | Warning |
| Hazard Symbols | Xi |
| Hazard Symbols Descriptions | Irritant |
| MDL Number | MFCD00013176 |
| Melting Point | ~148 C |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 261.29 |
| Net Weight | 100 |
| R-Phrases | 36/37/38 |
| RTECSNo | DG2455000 |
| S-Phrases | 26 |
| Synonyms | MS-222; Tricaine |
| Tariff Number | 29224985900 |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=A5040brand=SIAL |
| Application(s) | forensics and toxicologypharmaceutical (small molecule) |
| technique(s) | HPLC: suitable |
| InChI | 1S/C9H11NO2.CH4O3S/c1-2-12-9(11)7-4-3-5-8(10)6-7;1-5(2,3)4/h3-6H,2,10H2,1H3;1H3,(H,2,3,4) |
| format | neat |
| SMILES string | CS(O)(=O)=O.CCOC(=O)c1cccc(N)c1 |
| InChI key | FQZJYWMRQDKBQN-UHFFFAOYSA-N |
| grade | analytical standard |
| Quality Level | 100 |
| mp | ~148 C |
Description
3-Aminobenzoic Acid Ethyl Ester