01904 488599
3,5-Di-Tert-Butylsalicylic Acid, 97%
From £31.08 per (ex VAT)
3,5-Di-Tert-Butylsalicylic Acid, 97%
| Product Code | 149136-5G |
|---|---|
| Unit of Measure | 1X5GR |
| CAS Number | 19715-19-6 |
| MDL NUMBER | MFCD00059058 |
| EMPIRICAL FORMULA | C15H22O3 |
| Molecular Weight | 250.33 |
| Brand | SIGMA-ALDRICH |
Tiered Pricing - 149136-5G
| Qty | Discount | Price |
|---|---|---|
| 4+ | 8% | £34.87 |
| 12+ | 10% | £34.11 |
| 36+ | 12% | £33.35 |
| 72+ | 18% | £31.08 |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12352100 |
| ADRSuff | 1 |
| CAS Number | 19715-19-6 |
| EINECSNo | 243-246-6 |
| Flash Point | 179 C - closed cup |
| GHS Categories | Acute Tox. 4,Skin Irrit. 2,Eye Irrit. 2,STOT SE 3 |
| GHS Hazard Codes | H302-H315-H319-H335 |
| GHS Hazard Statements | Harmful if swallowed. Causes skin irritation. Causes serious eye irritation. May cause respiratory irritation. |
| GHS Pictograms | GHS07 |
| GHS Precaution Codes | P261 - P305 + P351 + P338 |
| GHS Precaution Statements | Avoid breathing dust/ fume/ gas/ mist/ vapours/ spray. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. |
| GHS Signal Words | Warning |
| Hazard Symbols | Xi |
| Hazard Symbols Descriptions | Irritant |
| MDL Number | MFCD00059058 |
| Melting Point | 157-162 C (lit.) |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.33 |
| Net Weight | 5 |
| Purity Grade | 0.97 |
| R-Phrases | 36/37/38 |
| S-Phrases | 26-36 |
| Tariff Number | 29182900900 |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=149136brand=ALDRICH |
| Assay | 97% |
| InChI key | ZWQBZEFLFSFEOS-UHFFFAOYSA-N |
| SMILES string | CC(C)(C)c1cc(C(O)=O)c(O)c(c1)C(C)(C)C |
| mp | 157-162 C (lit.) |
| Quality Level | 100 |
| InChI | 1S/C15H22O3/c1-14(2,3)9-7-10(13(17)18)12(16)11(8-9)15(4,5)6/h7-8,16H,1-6H3,(H,17,18) |
Description
3,5-Di-Tert-Butylsalicylic Acid, 97%