01904 488599
Bensulfuron-Methyl Pestanal.
From £102.00 per (ex VAT)
Bensulfuron-Methyl Pestanal.
| Product Code | 37897-100MG |
|---|---|
| Unit of Measure | 1X100MG |
| CAS Number | 83055-99-6 |
| MDL NUMBER | MFCD00128064 |
| EMPIRICAL FORMULA | C16H18N4O7S |
| Molecular Weight | 410.4 |
| Brand | SUPELCO |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 41116107 |
| ADRSuff | 1 |
| CAS Number | 83055-99-6 |
| ADR Not Allowed by Post | X |
| ADR Number of Danger | 90 |
| EINECSNo | 401-340-6 |
| Flash Point | Not applicable |
| GHS Categories | Skin Sens. 1,Aquatic Chronic 2 |
| GHS Hazard Codes | H317-H411 |
| GHS Hazard Statements | May cause an allergic skin reaction. Toxic to aquatic life with long lasting effects. |
| GHS Pictograms | GHS07,GHS09 |
| GHS Precaution Codes | P273 - P280 |
| GHS Precaution Statements | Avoid release to the environment. Wear protective gloves. |
| GHS Signal Words | Warning |
| Hazard Symbols | Xi,N |
| Hazard Symbols Descriptions | Irritant, Dangerous for the environment |
| MDL Number | MFCD00128064 |
| Melting Point | 179-184 C |
| Molecular Formula | C16H18N4O7S |
| Molecular Weight | 410.4 |
| Net Weight | 100 |
| R-Phrases | 43-51/53 |
| RTECSNo | DG8733000 |
| S-Phrases | 24-37-61 |
| Tariff Number | 29359090990 |
| Technical Name | BENSULFURON-METHYL |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=37897brand=SIAL |
| shelf life | limited shelf life, expiry date on the label |
| InChI | 1S/C16H18N4O7S/c1-25-12-8-13(26-2)18-15(17-12)19-16(22)20-28(23,24)9-10-6-4-5-7-11(10)14(21)27-3/h4-8H,9H2,1-3H3,(H2,17,18,19,20,22) |
| SMILES string | COC(=O)c1ccccc1CS(=O)(=O)NC(=O)Nc2nc(OC)cc(OC)n2 |
| format | neat |
| technique(s) | gas chromatography (GC): suitable |
| grade | analytical standard |
| Quality Level | 100 |
| InChI key | XMQFTWRPUQYINF-UHFFFAOYSA-N |
| Application(s) | agricultureenvironmental |
| product line | PESTANAL(R) |
| suitability | passes test for identity (NMR) |
| mp | 179-184 C |
| impurities | <=1% water (Karl Fischer) |
Description
Bensulfuron-Methyl Pestanal.