01904 488599
Benzene-D6, 99.6 Atom % D
From £123.00 per (ex VAT)
Benzene-D6, 99.6 Atom % D
| Product Code | 151815-25G |
|---|---|
| Unit of Measure | 1X25GR |
| CAS Number | 1076-43-3 |
| MDL NUMBER | MFCD00003010 |
| EMPIRICAL FORMULA | C6H6 |
| Molecular Weight | 84.15 |
| Synonyms | Hexadeuterobenzene |
| Brand | SIGMA-ALDRICH |
Tiered Pricing - 151815-25G
| Qty | Discount | Price |
|---|---|---|
| 4+ | 8% | £138.00 |
| 12+ | 10% | £135.00 |
| 36+ | 12% | £132.00 |
| 72+ | 18% | £123.00 |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12142201 |
| ADRSuff | 1 |
| CAS Number | 1076-43-3 |
| ADR Hazard Labels | 3 |
| ADR Not Allowed by Post | X |
| ADR Number of Danger | 33 |
| ADR Packing Group | 2 |
| ADR Primary Hazard Class | 3 |
| ADR Proper Shipping Name | Benzene |
| ADRNo | 1114 |
| Boiling Point | 79.1 C/760 mmHg (lit.) |
| Density | 0.950 g/mL at 25 C (lit.) |
| Dual Use Material | X |
| EINECSNo | 214-061-8 |
| Flash Point | -11 C - closed cup |
| GHS Categories | Flam. Liq. 2,Asp. Tox. 1,Skin Irrit. 2,Eye Irrit. 2,Muta. 1B,Carc. 1A,STOT RE 1,Aquatic Chronic 3 |
| GHS Hazard Codes | H225-H304-H315-H319-H340-H350-H372-H412 |
| GHS Hazard Statements | Highly flammable liquid and vapour. May be fatal if swallowed and enters airways. Causes skin irritation. Causes serious eye irritation. May cause genetic defects. May cause cancer. Causes damage to organs through prolonged or repeated exposure. Harmful t |
| GHS Pictograms | GHS02,GHS08,GHS07 |
| GHS Precaution Codes | P201 - P210 - P280 - P308 + P313 - P370 + P378 - P403 + P235 |
| GHS Precaution Statements | Obtain special instructions before use. Keep away from heat/sparks/open flames/hot surfaces. - No smoking. IF SWALLOWED: Immediately call a POISON CENTER or doctor/ physician. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact len |
| GHS Remarks | Correction: Note 'E' has been deleted |
| GHS Signal Words | Danger |
| Hazard Symbols | F,T |
| Hazard Symbols Descriptions | Highly flammable, Toxic |
| MDL Number | MFCD00003010 |
| Melting Point | 6.8 C (lit.) |
| Molecular Formula | C6H6 |
| Molecular Weight | 84.15 |
| Net Weight | 25 |
| R-Phrases | 45-46-11-36/38-48/23/24/25-65 |
| S-Phrases | 53-45 |
| Synonyms | Hexadeuterobenzene |
| Tariff Number | 28459010000 |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=151815brand=ALDRICH |
| Assay | >=99% (CP) |
| InChI | 1S/C6H6/c1-2-4-6-5-3-1/h1-6H/i1D,2D,3D,4D,5D,6D |
| InChI key | UHOVQNZJYSORNB-MZWXYZOWSA-N |
| SMILES string | [2H]c1c([2H])c([2H])c([2H])c([2H])c1[2H] |
| mass shift | M+6 |
| form | liquid |
| isotopic purity | 99.6 atom % D |
| Quality Level | 100 |
| expl. lim. | 0.34-6.3 % (lit.) |
| mp | 6.8 C (lit.) |
| technique(s) | NMR: suitable |
| impurities | <=0.01% waterwater |
| bp | 79.1 C/760 mmHg (lit.) |
| refractive index | n20/D 1.497 (lit.) |
Description
Benzene-D6, 99.6 Atom % D