01904 488599
(Benzotriazol-1-Yloxy)Tripyrrolidinophos
From £189.42 per (ex VAT)
(Benzotriazol-1-Yloxy)Tripyrrolidinophos
| Product Code | 12805-25G-F |
|---|---|
| Unit of Measure | 1X25GR |
| CAS Number | 128625-52-5 |
| MDL NUMBER | MFCD00077411 |
| EMPIRICAL FORMULA | C18H28F6N6OP2 |
| Molecular Weight | 520.39 |
| Synonyms | Pybop(R) |
| Brand | SIGMA-ALDRICH |
Tiered Pricing - 12805-25G-F
| Qty | Discount | Price |
|---|---|---|
| 4+ | 8% | £212.52 |
| 12+ | 10% | £207.90 |
| 36+ | 12% | £203.28 |
| 72+ | 18% | £189.42 |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12352000 |
| ADRSuff | 1 |
| CAS Number | 128625-52-5 |
| Storage Temperature | 2-8C |
| Flash Point | Not applicable |
| GHS Categories | Skin Irrit. 2,Eye Irrit. 2,STOT SE 3 |
| GHS Hazard Codes | H315-H319-H335 |
| GHS Hazard Statements | Causes skin irritation. Causes serious eye irritation. May cause respiratory irritation. |
| GHS Pictograms | GHS07 |
| GHS Precaution Codes | P261 - P305 + P351 + P338 |
| GHS Signal Words | Warning |
| Hazard Symbols | Xi |
| Hazard Symbols Descriptions | Irritant |
| MDL Number | MFCD00077411 |
| Melting Point | ~150 C; 154-156 C (dec.) (lit.) |
| Molecular Formula | C18H28F6N6OP2 |
| GHS Precaution Statements | Avoid breathing dust/ fume/ gas/ mist/ vapours/ spray. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. |
| Molecular Weight | 520.39 |
| Net Weight | 25 |
| R-Phrases | 36/37/38 |
| S-Phrases | 26-36 |
| Synonyms | PyBOP(R) |
| Tariff Number | 29339980900 |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=12805brand=SIAL |
| Quality Level | 200 |
| Application(s) | peptide synthesis |
| mp | 154-156 C (dec.) (lit.) |
| InChI | 1S/C18H28N6OP.F6P/c1-2-10-18-17(9-1)19-20-24(18)25-26(21-11-3-4-12-21,22-13-5-6-14-22)23-15-7-8-16-23;1-7(2,3,4,5)6/h1-2,9-10H,3-8,11-16H2;/q+1;-1 |
| InChI key | VIAFLMPQBHAMLI-UHFFFAOYSA-N |
| storage temp. | 2-8C |
| reaction suitability | reaction type: Coupling Reactions |
| form | solid |
| Assay | >=97.0% (TLC) |
| grade | purum |
| SMILES string | F[P-](F)(F)(F)(F)F.C1CCN(C1)[P+](On2nnc3ccccc23)(N4CCCC4)N5CCCC5 |
Description
(Benzotriazol-1-Yloxy)Tripyrrolidinophos