01904 488599
Chaps Hydrate, Bioreagent, Suitable For
From £256.96 per (ex VAT)
Chaps Hydrate, Bioreagent, Suitable For
| Product Code | C9426-5G |
|---|---|
| Unit of Measure | 1X5GR |
| CAS Number | 331717-45-4 |
| EMPIRICAL FORMULA | C32H58N2O7S |
| Molecular Weight | 614.88 (anhydrous basis) |
| Synonyms | 3-[(3-Cholamidopropyl)Dimethylammonio]-1-Propanesulfonate Hydrate; Chaps |
| Brand | SIGMA-ALDRICH |
Tiered Pricing - C9426-5G
| Qty | Discount | Price |
|---|---|---|
| 4+ | 8% | £268.64 |
| 12+ | 10% | £262.80 |
| 36+ | 12% | £256.96 |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12352200 |
| ADRSuff | 1 |
| CAS Number | 331717-45-4 |
| Storage Temperature | room temp |
| Flash Point | Not applicable |
| GHS Categories | Repr. 1B |
| GHS Hazard Codes | H360 |
| GHS Hazard Statements | May damage fertility or the unborn child. |
| GHS Pictograms | GHS08 |
| GHS Precaution Codes | P201 - P280 - P308 + P313 |
| GHS Signal Words | Danger |
| Hazard Symbols | T |
| Hazard Symbols Descriptions | Toxic |
| Melting Point | 157 C (dec.) (lit.) |
| GHS Precaution Statements | Obtain special instructions before use. Avoid breathing dust/ fume/ gas/ mist/ vapours/ spray. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. IF exposed or concerned: Get me |
| Molecular Formula | C32H58N2O7S |
| Net Weight | 5 |
| R-Phrases | 61-36/37/38 |
| S-Phrases | 53-22-26-35-36/37 |
| Synonyms | 3-[(3-Cholamidopropyl)dimethylammonio]-1-propanesulfonate hydrate; CHAPS |
| Tariff Number | 29242970990 |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=C9426brand=SIGMA |
| solubility | water: 50 mg/mL, clear, colorless |
| mol wt | 614.88 g/mol (anhydrous basis) |
| technique(s) | protein quantification: suitable |
| Quality Level | 200 |
| InChI key | SJCUTFKCLFLIFE-JWTJKVBLSA-N |
| InChI | 1S/C32H58N2O7S.H2O/c1-21(8-11-29(38)33-14-6-15-34(4,5)16-7-17-42(39,40)41)24-9-10-25-30-26(20-28(37)32(24,25)3)31(2)13-12-23(35)18-22(31)19-27(30)36;/h21-28,30,35-37H,6-20H2,1-5H3,(H-,33,38,39,40,41);1H2/t21-,22+,23-,24-,25+,26+,27-,28+,30+,31+,32-;/m1./s1 |
| suitability | suitable for electrophoresis |
| product line | BioReagent |
| impurities | <0.04% DMF |
| storage temp. | room temp |
| form | powder |
| Assay | >=98% (HPLC) |
| description | zwitterionic |
| mp | 157 C (dec.) (lit.) |
| SMILES string | O.C[C@H](CCC(=O)NCCC[N+](C)(C)CCCS([O-])(=O)=O)[C@H]1CC[C@H]2[C@@H]3[C@H](O)C[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3C[C@H](O)[C@]12C |
Description
Chaps Hydrate, Bioreagent, Suitable For