01904 488599
Chaps, 50G
From £969.00 per (ex VAT)
Chaps, 50G
| Product Code | 10810126001 |
|---|---|
| Unit of Measure | 1XEA |
| CAS Number | 75621-03-3 |
| Brand | SIGMA-ALDRICH |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | WICE |
| UNSPSC Code | 12350000 |
| ADRSuff | 1 |
| CAS Number | 75621-03-3 |
| GHS Categories | NH |
| GHS Hazard Codes | H302-H315-H319 |
| GHS Hazard Statements | Harmful if swallowed. Causes skin irritation. Causes serious eye irritation. |
| GHS Pictograms | GHS07 |
| GHS Precaution Codes | P264 - P270 - P280 - P301 + P312 + P330 - P337 + P313 - P501 |
| GHS Signal Words | Warning |
| Net Weight | 0.089 |
| Tariff Number | 29242970990 |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=CHAPS-RObrand=DETERGENT |
| technique(s) | dialysis: suitable |
| CMC | 4 mM |
| form | crystals |
| Absorption | <0.06% at 278 nm in water at 1 % (w/v) (Ease of removal*: ++Note:* Arbitrary scale ranges from ++ to -) |
| manufacturer/tradename | Roche |
| description | zwitterionic |
| packaging | pkg of 50 g (10810126001) |
| mp | 157 C (dec.) (lit.) |
| SMILES string | O.C[C@H](CCC(=O)NCCC[N+](C)(C)CCCS([O-])(=O)=O)[C@H]1CC[C@H]2[C@@H]3[C@H](O)C[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3C[C@H](O)[C@]12C |
| solubility | >50% (Aqueous solutions) |
| mol wt | 614.88 g/mol (anhydrous basis) |
| InChI key | SJCUTFKCLFLIFE-JWTJKVBLSA-N |
| storage temp. | 2-8C |
| shipped in | wet ice |
| InChI | 1S/C32H58N2O7S.H2O/c1-21(8-11-29(38)33-14-6-15-34(4,5)16-7-17-42(39,40)41)24-9-10-25-30-26(20-28(37)32(24,25)3)31(2)13-12-23(35)18-22(31)19-27(30)36;/h21-28,30,35-37H,6-20H2,1-5H3,(H-,33,38,39,40,41);1H2/t21-,22+,23-,24-,25+,26+,27-,28+,30+,31+,32-;/m1./s1 |
| Assay | 98% (from N) |
Description
Chaps, 50G