01904 488599
Chlortetracycline Hydrochloride,>=91.0%
From £293.37 per (ex VAT)
Chlortetracycline Hydrochloride,>=91.0%
| Product Code | C4881-100G |
|---|---|
| Unit of Measure | 1X100GR |
| CAS Number | 64-72-2 |
| MDL NUMBER | MFCD00082440 |
| EMPIRICAL FORMULA | C22H23ClN2O8 |
| Molecular Weight | 515.34 |
| Synonyms | 7-Chlorotetracycline Hydrochloride |
| Brand | SIGMA-ALDRICH |
Tiered Pricing - C4881-100G
| Qty | Discount | Price |
|---|---|---|
| 4+ | 13% | £331.47 |
| 12+ | 15% | £323.85 |
| 36+ | 17% | £316.23 |
| 72+ | 23% | £293.37 |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12350000 |
| ADRSuff | 1 |
| CAS Number | 64-72-2 |
| Storage Temperature | -20C |
| EINECSNo | 200-591-7 |
| Flash Point | Not applicable |
| GHS Categories | Skin Irrit. 2,Eye Irrit. 2,STOT SE 3 |
| GHS Hazard Codes | H315-H319-H335 |
| GHS Hazard Statements | Causes skin irritation. Causes serious eye irritation. May cause respiratory irritation. |
| GHS Pictograms | GHS07 |
| GHS Precaution Codes | P261 - P305 + P351 + P338 |
| GHS Precaution Statements | Avoid breathing dust/ fume/ gas/ mist/ vapours/ spray. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. |
| GHS Signal Words | Warning |
| Hazard Symbols | Xi |
| Hazard Symbols Descriptions | Irritant |
| MDL Number | MFCD00082440 |
| Melting Point | 210-215 C (dec.) (lit.) |
| Molecular Formula | C22H23ClN2O8 |
| Molecular Weight | 515.34 |
| Net Weight | 100 |
| R-Phrases | 36/37/38 |
| RTECSNo | QI7800000 |
| S-Phrases | 26 |
| Synonyms | 7-Chlorotetracycline hydrochloride |
| Tariff Number | 29413000000 |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=C4881brand=SIGMA |
| Quality Level | 200 |
| pKa (25 C) | 3.3 |
| Assay | >=91.0% dry basis (HPLC) |
| mp | 210-215 C (dec.) (lit.) |
| InChI key | CBHYYLPALVVVEY-LYNLVHCPSA-N |
| Antibiotic Activity Spectrum | Gram-positive bacteria |
| Mode of action | protein synthesis | interferes |
| InChI | 1S/C22H23ClN2O8.ClH/c1-21(32)7-6-8-15(25(2)3)17(28)13(20(24)31)19(30)22(8,33)18(29)11(7)16(27)12-10(26)5-4-9(23)14(12)21;/h4-5,7-8,15,26,28-29,32-33H,6H2,1-3H3,(H2,24,31);1H/t7?,8-,15-,21-,22-;/m0./s1 |
| SMILES string | Cl.CN(C)[C@H]1[C@@H]2CC3C(=C(O)[C@]2(O)C(=O)C(C(N)=O)=C1O)C(=O)c4c(O)ccc(Cl)c4[C@@]3(C)O |
| form | powder |
| solubility | 1 M NaOH: 50 mg/mL |
| storage temp. | -20C |
Description
Chlortetracycline Hydrochloride,>=91.0%