01904 488599
Citric Acid Monohydrate Acs Reagent
£64.22 Each (ex VAT)
Citric Acid Monohydrate Acs Reagent
| Product Code | C1909-500G |
|---|---|
| Unit of Measure | 1X500GR |
| CAS Number | 5949-29-1 |
| MDL NUMBER | MFCD00149972 |
| EMPIRICAL FORMULA | C6H8O7 |
| Molecular Weight | 210.14 |
| Brand | SIGMA-ALDRICH |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32030000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12352100 |
| ADRSuff | 1 |
| CAS Number | 5949-29-1 |
| EINECSNo | 201-069-1 |
| Flash Point | 173.9 C |
| GHS Categories | Eye Irrit. 2 |
| GHS Hazard Codes | H319 |
| GHS Hazard Statements | Causes serious eye irritation. |
| GHS Pictograms | GHS07 |
| GHS Precaution Codes | P305 + P351 + P338 |
| GHS Precaution Statements | Avoid breathing dust/ fume/ gas/ mist/ vapours/ spray. Wear protective gloves/ eye protection/ face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. |
| GHS Signal Words | Warning |
| Hazard Symbols | Xi |
| Hazard Symbols Descriptions | Irritant |
| MDL Number | MFCD00149972 |
| Molecular Formula | C6H8O7 |
| Molecular Weight | 210.14 |
| Net Weight | 500 |
| R-Phrases | 36 |
| RTECSNo | GE7810000 |
| S-Phrases | 26 |
| Tariff Number | 29181400900 |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=C1909brand=SIAL |
| Quality Level | 200 |
| grade | ACS reagent |
| Anion Traces | phosphate (PO43-): <=0.001% |
| solubility | H2O: 84.0 % (w/w) at 100 C (Citric acid in water) |
| pKa | (1) 3.13, (2) 4.76, (3) 6.4 |
| InChI key | YASYEJJMZJALEJ-UHFFFAOYSA-N |
| InChI | 1S/C6H8O7.H2O/c7-3(8)1-6(13,5(11)12)2-4(9)10;/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);1H2 |
| Assay | >=99.0% |
| form | powder |
| ign. residue | <=0.02% |
| impurities | <=0.005% Insoluble matter |
| cation traces | Pb: <=2 ppm |
| SMILES string | OC(CC(O)(C(O)=O)CC(O)=O)=O.O |
Description
Citric Acid Monohydrate Acs Reagent