01904 488599
Cresyl Violet Perchlorate
From £55.30 per (ex VAT)
Cresyl Violet Perchlorate
| Product Code | 255246-100MG |
|---|---|
| Unit of Measure | 1X100MG |
| CAS Number | 41830-80-2 |
| MDL NUMBER | MFCD00012671 |
| EMPIRICAL FORMULA | C16H11N3O |
| Molecular Weight | 361.74 |
| Synonyms | Oxazine 9 Perchlorate |
| Brand | SIGMA-ALDRICH |
Tiered Pricing - 255246-100MG
| Qty | Discount | Price |
|---|---|---|
| 4+ | 18% | £62.98 |
| 12+ | 20% | £61.44 |
| 36+ | 22% | £59.90 |
| 72+ | 28% | £55.30 |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12171500 |
| ADRSuff | 1 |
| CAS Number | 41830-80-2 |
| Storage Temperature | room temp |
| EINECSNo | 255-561-6 |
| Flash Point | Not applicable |
| GHS Categories | Skin Irrit. 2,Eye Irrit. 2,STOT SE 3 |
| GHS Hazard Codes | H315-H319-H335 |
| GHS Hazard Statements | Causes skin irritation. Causes serious eye irritation. May cause respiratory irritation. |
| GHS Pictograms | GHS07 |
| GHS Precaution Codes | P261 - P305 + P351 + P338 |
| GHS Signal Words | Warning |
| Hazard Symbols | Xi |
| Hazard Symbols Descriptions | Irritant |
| MDL Number | MFCD00012671 |
| Molecular Formula | C16H11N3O |
| Molecular Weight | 361.74 |
| Net Weight | 100 |
| R-Phrases | 36/37/38 |
| S-Phrases | 26-36 |
| Synonyms | Oxazine 9 perchlorate |
| Tariff Number | 32129000000 |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=255246brand=ALDRICH |
| GHS Precaution Statements | Avoid breathing dust/ fume/ gas/ mist/ vapours/ spray. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. |
| storage temp. | room temp |
| Application(s) | diagnostic assay manufacturinghematologyhistology |
| Assay | >96.5% (HPLC) |
| Quality Level | 100 |
| SMILES string | OCl(=O)(=O)=O.Nc1cc2OC3=CC(=N)C=CC3=Nc2c4ccccc14 |
| lambdamax | 602 nm |
| InChI | 1S/C16H11N3O.ClHO4/c17-9-5-6-13-14(7-9)20-15-8-12(18)10-3-1-2-4-11(10)16(15)19-13;2-1(3,4)5/h1-8,17H,18H2;(H,2,3,4,5) |
| form | powder |
| epsilon (extinction coefficient) | >=7000 at 316-322 nm |
| fluorescence | lambdaem 602 nm in ethanol |
| InChI key | YZUJISGZMSLVAU-UHFFFAOYSA-N |
Description
Cresyl Violet Perchlorate