01904 488599
Cycloheximide Ready Made
From £113.19 per (ex VAT)
Cycloheximide Ready Made
| Product Code | C4859-1ML |
|---|---|
| Unit of Measure | 1X1ML |
| CAS Number | 66-81-9 |
| MDL NUMBER | MFCD00082346 |
| EMPIRICAL FORMULA | C15H23NO4 |
| Molecular Weight | 281.35 |
| Synonyms | Chx |
| Brand | SIGMA-ALDRICH |
Tiered Pricing - C4859-1ML
| Qty | Discount | Price |
|---|---|---|
| 4+ | 13% | £127.89 |
| 12+ | 15% | £124.95 |
| 36+ | 17% | £122.01 |
| 72+ | 23% | £113.19 |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12352200 |
| ADRSuff | B |
| CAS Number | 66-81-9 |
| ADR Hazard Labels | 6.1 |
| ADR Number of Danger | 63 |
| ADR Packing Group | 2 |
| ADR Primary Hazard Class | 6.1 |
| ADR Proper Shipping Name | Toxic liquid, organic, n.o.s. |
| ADRNo | 2810 |
| Storage Temperature | 2-8C |
| Flash Point | 87 C - closed cup |
| GHS Categories | Acute Tox. 3,Skin Irrit. 2,Eye Irrit. 2,Muta. 2,Repr. 1B,Aquatic Chronic 3 |
| GHS Hazard Codes | H301-H315-H319-H341-H360D-H412 |
| GHS Hazard Statements | Toxic if swallowed. Causes skin irritation. Causes serious eye irritation. Suspected of causing genetic defects. May damage the unborn child. Harmful to aquatic life with long lasting effects. |
| GHS Pictograms | GHS06,GHS08 |
| GHS Precaution Codes | P201 - P280 - P301 + P330 + P331 + P310 - P305 + P351 + P338 - P308 + P313 |
| GHS Precaution Statements | Obtain special instructions before use. Avoid release to the environment. Use personal protective equipment as required. IF SWALLOWED: Immediately call a POISON CENTER or doctor/ physician. IF IN EYES: Rinse cautiously with water for several minutes. Remo |
| GHS Signal Words | Danger |
| Hazard Symbols | T+ |
| Hazard Symbols Descriptions | Very toxic |
| MDL Number | MFCD00082346 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 |
| Net Weight | 1 |
| R-Phrases | 61-28-52/53-68 |
| S-Phrases | 53-28-36/37-45-61 |
| Synonyms | CHX |
| Tariff Number | 38089490900 |
| Technical Name | CYCLOHEXIMIDE |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=C4859brand=SIGMA |
| Antibiotic Activity Spectrum | fungi |
| Quality Level | 300 |
| storage temp. | 2-8C |
| SMILES string | O=C1[C@@]([C@H](O)CC2CC(NC(C2)=O)=O)([H])C[C@@H](C)C[C@@H]1C |
| InChI | 1S/C15H23NO4/c1-8-3-9(2)15(20)11(4-8)12(17)5-10-6-13(18)16-14(19)7-10/h8-12,17H,3-7H2,1-2H3,(H,16,18,19)/t8-,9-,11-,12+/m0/s1 |
| Mode of action | protein synthesis | interferes |
| concentration | 100 mg/mL in DMSO |
| InChI key | YPHMISFOHDHNIV-FSZOTQKASA-N |
| Gene Information | human ... FKBP1A(2280), PIN1(5300) |
| biological source | microbial |
| solubility | DMSO: soluble |
| description | suitable for testing specifications (CHO C. growth inhibitor) |
| form | solution |
Description
Cycloheximide Ready Made