01904 488599
D(+)-Saccharose Extra Pure, Dab, Ph. Eur
From £32.64 per (ex VAT)
D(+)-Saccharose Extra Pure, Dab, Ph. Eur
| Product Code | 16104-100G |
|---|---|
| Unit of Measure | 1X100GR |
| CAS Number | 57-50-1 |
| MDL NUMBER | MFCD00006626 |
| EMPIRICAL FORMULA | C12H22O11 |
| Molecular Weight | 342.3 |
| Synonyms | Alpha-D-Glc-(1->2)-Beta-D-Fru; Alpha-D-Glucopyranosyl Beta-D-Fructofuranoside; Beta-D-Fructofuranosyl-Alpha-D-Glucopyranoside; D(+)-Saccharose; Sugar |
| Brand | SIGMA-ALDRICH |
Tiered Pricing - 16104-100G
| Qty | Discount | Price |
|---|---|---|
| 4+ | 8% | £36.62 |
| 12+ | 10% | £35.82 |
| 36+ | 12% | £35.02 |
| 72+ | 18% | £32.64 |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12352201 |
| ADRSuff | 1 |
| CAS Number | 57-50-1 |
| EINECSNo | 200-334-9 |
| Flash Point | Not applicable |
| GHS Categories | NH |
| GHS Hazard Codes | NH |
| GHS Hazard Statements | NH |
| GHS Pictograms | - |
| GHS Precaution Codes | - |
| GHS Remarks | Not a dangerous substance according to GHS. |
| GHS Signal Words | - |
| MDL Number | MFCD00006626 |
| Melting Point | 185-187 C (lit.) |
| Molecular Formula | C12H22O11 |
| Molecular Weight | 342.3 |
| Net Weight | 100 |
| RTECSNo | WN6500000 |
| Synonyms | alpha-D-Glc-(1->2)-beta-D-Fru; alpha-D-Glucopyranosyl beta-D-fructofuranoside; beta-D-Fructofuranosyl-alpha-D-glucopyranoside; D(+)-Saccharose; Sugar |
| Tariff Number | 17019990000 |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=16104brand=SIAL |
| solubility | alcohol: insoluble (Dehydrated) |
| Quality Level | 200 |
| Anion Traces | chloride (Cl-): <=30 mg/kg |
| impurities | <=250 EU/g endotoxins (LAL test) |
| ign. residue | <=0.01% (as SO4) |
| agency | meets analytical specifications of Ph. Eur. |
| InChI key | CZMRCDWAGMRECN-UGDNZRGBSA-N |
| grade | puriss. |
| cation traces | Pb: <=0.5 mg/kg |
| optical activity | [alpha]20/D +66.3 to +67.0, c = 26% in H2O |
| quality | meets analytical specification of Ph. Eur., BP, NF |
| mp | 185-187 C (lit.) |
| form | solid |
| InChI | 1S/C12H22O11/c13-1-4-6(16)8(18)9(19)11(21-4)23-12(3-15)10(20)7(17)5(2-14)22-12/h4-11,13-20H,1-3H2/t4-,5-,6-,7-,8+,9-,10+,11-,12+/m1/s1 |
| conductivity | <=35 muS/cm |
| loss | <=0.1% loss on drying, 105 C, 3 h |
| description | color index <= 45 |
| SMILES string | OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@@H]1O |
| Application(s) | pharmaceutical (small molecule) |
| suitability | complies for appearance of solution |
Description
D(+)-Saccharose Extra Pure, Dab, Ph. Eur