01904 488599
Deoxycholic Acid, >=98% (Hplc)
From £343.42 per (ex VAT)
Deoxycholic Acid, >=98% (Hplc)
| Product Code | D2510-500G |
|---|---|
| Unit of Measure | 1X500GR |
| CAS Number | 83-44-3 |
| MDL NUMBER | MFCD00003673 |
| EMPIRICAL FORMULA | C24H4O4 |
| Molecular Weight | 392.57 |
| Synonyms | 3Alpha,12Alpha-Dihydroxy-5Beta-Cholanic Acid; 7-Deoxycholic Acid; Desoxycholic Acid |
| Brand | SIGMA-ALDRICH |
Tiered Pricing - D2510-500G
| Qty | Discount | Price |
|---|---|---|
| 4+ | 13% | £388.02 |
| 12+ | 15% | £379.10 |
| 36+ | 17% | £370.18 |
| 72+ | 23% | £343.42 |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12161900 |
| ADRSuff | 1 |
| CAS Number | 83-44-3 |
| Storage Temperature | room temp |
| EINECSNo | 201-478-5 |
| Flash Point | Not applicable |
| GHS Categories | Acute Tox. 4 |
| GHS Hazard Codes | H302 |
| GHS Hazard Statements | Harmful if swallowed. |
| GHS Pictograms | GHS07 |
| GHS Precaution Codes | P301 + P312 + P330 |
| GHS Precaution Statements | Avoid breathing dust/ fume/ gas/ mist/ vapours/ spray. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. |
| GHS Signal Words | Warning |
| Hazard Symbols | Xn |
| Hazard Symbols Descriptions | Harmful |
| MDL Number | MFCD00003673 |
| Melting Point | 171-174 C (lit.) |
| Molecular Formula | C24H4O4 |
| Molecular Weight | 392.57 |
| Net Weight | 500 |
| R-Phrases | 22-36/37/38 |
| RTECSNo | FZ2100000 |
| S-Phrases | 26-36 |
| Synonyms | 3alpha,12alpha-Dihydroxy-5beta-cholanic acid; 7-Deoxycholic acid; Desoxycholic acid |
| Tariff Number | 29181930200 |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=D2510brand=SIGMA |
| Quality Level | 200 |
| InChI | 1S/C24H40O4/c1-14(4-9-22(27)28)18-7-8-19-17-6-5-15-12-16(25)10-11-23(15,2)20(17)13-21(26)24(18,19)3/h14-21,25-26H,4-13H2,1-3H3,(H,27,28)/t14-,15-,16-,17+,18-,19+,20+,21+,23+,24-/m1/s1 |
| functional group | carboxylic acid |
| mp | 171-174 C (lit.) |
| description | anionic |
| Gene Information | human ... ATIC(471) |
| storage temp. | room temp |
| shipped in | ambient |
| biological source | bovine bile (ex gall bladder) |
| form | powder |
| Assay | >=98% (HPLC) |
| SMILES string | C[C@H](CCC(O)=O)[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3C[C@H](O)[C@]12C |
| mol wt | 392.57 g/mol |
| InChI key | KXGVEGMKQFWNSR-LLQZFEROSA-N |
Description
Deoxycholic Acid, >=98% (Hplc)