01904 488599
Di-Tert-Butyl Dicarbonate
From £391.96 per (ex VAT)
Di-Tert-Butyl Dicarbonate
| Product Code | 34660-500G-F |
|---|---|
| Unit of Measure | 1X500GR |
| CAS Number | 24424-99-5 |
| MDL NUMBER | MFCD00008805 |
| EMPIRICAL FORMULA | CH18O5 |
| Molecular Weight | 218.25 |
| Synonyms | Boc2O; Boc Anhydride; Di-Tert-Butyl Pyrocarbonate |
| Brand | SIGMA-ALDRICH |
Tiered Pricing - 34660-500G-F
| Qty | Discount | Price |
|---|---|---|
| 4+ | 8% | £439.76 |
| 12+ | 10% | £430.20 |
| 36+ | 12% | £420.64 |
| 72+ | 18% | £391.96 |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12352000 |
| ADRSuff | A |
| CAS Number | 24424-99-5 |
| ADR Hazard Labels | 6.1 |
| ADR Number of Danger | 663 |
| ADR Packing Group | 1 |
| ADR Primary Hazard Class | 6.1 |
| ADR Proper Shipping Name | Toxic liquid, flammable, organic, n.o.s. |
| ADR SubHaz Classes | 3 |
| ADRNo | 2929 |
| Boiling Point | 56-57 C/0.5 mmHg (lit.) |
| Storage Temperature | 2-8C |
| Density | 0.95 g/mL at 25 C (lit.) |
| EINECSNo | 246-240-1 |
| Flash Point | 37 C - closed cup |
| GHS Categories | Flam. Liq. 3,Skin Irrit. 2,Skin Sens. 1,Eye Dam. 1,Acute Tox. 1,STOT SE 3 |
| GHS Hazard Codes | H226-H315-H317-H318-H330-H335 |
| GHS Hazard Statements | Flammable liquid and vapour. Causes skin irritation. May cause an allergic skin reaction. Causes serious eye damage. Fatal if inhaled. May cause respiratory irritation. |
| GHS Pictograms | GHS02,GHS06,GHS05 |
| GHS Precaution Codes | P210 - P260 - P280 - P304 + P340 + P310 - P305 + P351 + P338 + P310 - P370 + P378 |
| GHS Precaution Statements | Do not breathe dust/ fume/ gas/ mist/ vapours/ spray. Wear protective gloves. Wear respiratory protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. Immediately call a |
| GHS Signal Words | Danger |
| Hazard Symbols | T+ |
| Hazard Symbols Descriptions | Very toxic |
| MDL Number | MFCD00008805 |
| Melting Point | 23 C (lit.) |
| Molecular Formula | CH18O5 |
| Molecular Weight | 218.25 |
| Net Weight | 500 |
| R-Phrases | 10-26-36/37/38-43 |
| RTECSNo | HT0230000 |
| S-Phrases | 7/9-16-26-28-36/37/39-45 |
| Synonyms | Boc2O; Boc anhydride; Di-tert-butyl pyrocarbonate |
| Tariff Number | 29209010500 |
| Technical Name | DI-TERT-BUTYL DICARBONATE |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=34660brand=SIAL |
| Quality Level | 200 |
| InChI | 1S/C10H18O5/c1-9(2,3)14-7(11)13-8(12)15-10(4,5)6/h1-6H3 |
| Application(s) | peptide synthesis |
| SMILES string | CC(C)(C)OC(=O)OC(=O)OC(C)(C)C |
| InChI key | DYHSDKLCOJIUFX-UHFFFAOYSA-N |
| bp | 56-57 C/0.5 mmHg (lit.) |
| Assay | >=98.0% (GC) |
| storage temp. | 2-8C |
| mp | 23 C (lit.) |
| refractive index | n20/D 1.409 (lit.) |
Description
Di-Tert-Butyl Dicarbonate