01904 488599
Etoxazole Pestanal.
From £148.00 per (ex VAT)
Etoxazole Pestanal.
| Product Code | 32506-50MG |
|---|---|
| Unit of Measure | 1X50MG |
| CAS Number | 153233-91-1 |
| MDL NUMBER | MFCD07363987 |
| EMPIRICAL FORMULA | C21H23F2NO2 |
| Molecular Weight | 359.41 |
| Synonyms | (Rs)-5-Tert-Butyl-2-[2-(2,6-Difluorophenyl)-4,5-Dihydro-1,3-Oxazol-4-Yl]Phenetole; 4-(4-Tert-Butyl-2-Ethoxyphenyl)-2-(2,6-Difluorophenyl)-4,5-Dihydrooxazole |
| Brand | SUPELCO |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 41116107 |
| ADRSuff | 1 |
| CAS Number | 153233-91-1 |
| ADR Not Allowed by Post | X |
| ADR Number of Danger | 90 |
| Flash Point | 457 C |
| GHS Categories | Acute Tox. 4,Aquatic Acute 1,Aquatic Chronic 1 |
| GHS Hazard Codes | H332-H400-H410 |
| GHS Hazard Statements | Harmful if inhaled. Very toxic to aquatic life. Very toxic to aquatic life with long lasting effects. |
| GHS Pictograms | GHS07,GHS09 |
| GHS Precaution Codes | P261 - P273 - P304 + P340 + P312 - P391 - P501 |
| GHS Precaution Statements | Avoid release to the environment. Dispose of contents/ container to an approved waste disposal plant. |
| GHS Signal Words | Warning |
| Hazard Symbols | N |
| Hazard Symbols Descriptions | Dangerous for the environment |
| MDL Number | MFCD07363987 |
| Molecular Formula | C21H23F2NO2 |
| Molecular Weight | 359.41 |
| Net Weight | 50 |
| R-Phrases | 50/53 |
| RTECSNo | RP6795100 |
| S-Phrases | 60-61 |
| Synonyms | (RS)-5-tert-Butyl-2-[2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazol-4-yl]phenetole; 4-(4-tert-Butyl-2-ethoxyphenyl)-2-(2,6-difluorophenyl)-4,5-dihydrooxazole |
| Tariff Number | 29349990840 |
| Technical Name | Etoxazole |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=32506brand=SIAL |
| InChI | 1S/C21H23F2NO2/c1-5-25-18-11-13(21(2,3)4)9-10-14(18)17-12-26-20(24-17)19-15(22)7-6-8-16(19)23/h6-11,17H,5,12H2,1-4H3 |
| SMILES string | CCOc1cc(ccc1C2COC(=N2)c3c(F)cccc3F)C(C)(C)C |
| shelf life | limited shelf life, expiry date on the label |
| format | neat |
| technique(s) | gas chromatography (GC): suitable |
| grade | analytical standard |
| Quality Level | 100 |
| Application(s) | agricultureenvironmental |
| product line | PESTANAL(R) |
| InChI key | IXSZQYVWNJNRAL-UHFFFAOYSA-N |
Description
Etoxazole Pestanal.