01904 488599
Boc-Trp-Oh, >=99.0% Tlc
From £31.73 per (ex VAT)
Boc-Trp-Oh, >=99.0% Tlc
| Product Code | 15512-5G-F |
|---|---|
| Unit of Measure | 1X5GR |
| CAS Number | 13139-14-5 |
| MDL NUMBER | MFCD00065595 |
| EMPIRICAL FORMULA | C16H2N2O4 |
| Molecular Weight | 304.34 |
| Synonyms | Nalpha-(Tert-Butoxycarbonyl)-L-Tryptophan; Nalpha-Boc-L-Tryptophan |
| Brand | SIGMA-ALDRICH |
Tiered Pricing - 15512-5G-F
| Qty | Discount | Price |
|---|---|---|
| 4+ | 8% | £35.60 |
| 12+ | 10% | £34.83 |
| 36+ | 12% | £34.06 |
| 72+ | 18% | £31.73 |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12352200 |
| ADRSuff | 1 |
| CAS Number | 13139-14-5 |
| EINECSNo | 236-072-7 |
| Flash Point | Not applicable |
| GHS Categories | NH |
| GHS Hazard Codes | NH |
| GHS Hazard Statements | NH |
| GHS Pictograms | - |
| GHS Precaution Codes | - |
| GHS Remarks | Not a dangerous substance according to GHS. |
| GHS Signal Words | - |
| MDL Number | MFCD00065595 |
| Melting Point | 136 C (dec.) (lit.) |
| Molecular Formula | C16H2N2O4 |
| Molecular Weight | 304.34 |
| Net Weight | 5 |
| Synonyms | Nalpha-(tert-Butoxycarbonyl)-L-tryptophan; Nalpha-Boc-L-tryptophan |
| Tariff Number | 29339980900 |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=15512brand=ALDRICH |
| Quality Level | 200 |
| Application(s) | peptide synthesis |
| reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| InChI | 1S/C16H20N2O4/c1-16(2,3)22-15(21)18-13(14(19)20)8-10-9-17-12-7-5-4-6-11(10)12/h4-7,9,13,17H,8H2,1-3H3,(H,18,21)(H,19,20)/t13-/m0/s1 |
| Assay | >=99.0% (TLC) |
| SMILES string | CC(C)(C)OC(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(O)=O |
| mp | 136 C (dec.) (lit.) |
| optical activity | [alpha]20/D -20+/-1, c = 1% in DMF |
| InChI key | NFVNYBJCJGKVQK-ZDUSSCGKSA-N |
| vapor density | 1.03 (vs air) |
| ign. residue | <=0.01% (as SO4) |
| quality | meets analytical specification of USP |
| vapor pressure | 52 mmHg ( 37 C) |
| concentration | 25-50% |
| suitability | corresponds for identity |
| contains | 9.0-15.0% methanol as stabilizer (GC) |
| autoignition temp. | 572 F |
| impurities | acidic reac. substances, complies |
| Density | 1.09 g/mL at 25 C (lit.) |
Description
Boc-Trp-Oh, >=99.0% Tlc