01904 488599
G418 Solution, 100 Ml
From £506.00 per (ex VAT)
G418 Solution, 100 Ml
| Product Code | 4727894001 |
|---|---|
| Unit of Measure | 1XEA |
| Brand | SIGMA-ALDRICH |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | WICE |
| UNSPSC Code | 12350000 |
| ADRSuff | 1 |
| GHS Categories | NH |
| GHS Hazard Codes | H317-H334 |
| GHS Hazard Statements | May cause an allergic skin reaction. May cause allergy or asthma symptoms or breathing difficulties if inhaled. |
| GHS Pictograms | GHS08 |
| GHS Precaution Codes | P261 - P280 - P284 - P304 + P340 - P333 + P313 - P342 + P311 |
| GHS Signal Words | Danger |
| Net Weight | 0.217 |
| Tariff Number | 29419000000 |
| Mode of action | protein synthesis | inhibits |
| manufacturer/tradename | Roche |
| packaging | pkg of 20 mL (04727878001 [equivalent to 1 g]) |
| technique(s) | transfection: suitable |
| form | solution |
| Quality Level | 100 |
| InChI key | UHEPSJJJMTWUCP-NKCAIAFTSA-N |
| storage temp. | 2-8C |
| shipped in | wet ice |
| concentration | 50 mg/mL |
| InChI | 1S/C20H40N4O10.2H2O4S/c1-6(25)14-11(27)10(26)9(23)18(32-14)33-15-7(21)4-8(22)16(12(15)28)34-19-13(29)17(24-3)20(2,30)5-31-19;2*1-5(2,3)4/h6-19,24-30H,4-5,21-23H2,1-3H3;2*(H2,1,2,3,4)/t6?,7-,8+,9+,10+,11-,12-,13-,14+,15+,16-,17-,18+,19-,20+;;/m0../s1 |
| Antibiotic Activity Spectrum | protozoa |
| mol wt | 692.7 Da |
| Assay | =98% (TLC) |
| SMILES string | OS(O)(=O)=O.OS(O)(=O)=O.CN[C@H]1[C@H](O)[C@@H](OC[C@@]1(C)O)O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H]([C@H](C)O)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O |
Description
G418 Solution, 100 Ml