01904 488599
Giemsa Stain, Certified
From £113.04 per (ex VAT)
Giemsa Stain, Certified
| Product Code | G5637-5G |
|---|---|
| Unit of Measure | 1X5GR |
| CAS Number | 51811-82-6 |
| MDL NUMBER | MFCD00081642 |
| EMPIRICAL FORMULA | C14H14ClN3S |
| Molecular Weight | 291.8 |
| Synonyms | Azure Mixture Sicc. Giemsa Stain |
| Brand | SIGMA-ALDRICH |
Tiered Pricing - G5637-5G
| Qty | Discount | Price |
|---|---|---|
| 4+ | 18% | £128.74 |
| 12+ | 20% | £125.60 |
| 36+ | 22% | £122.46 |
| 72+ | 28% | £113.04 |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12171500 |
| ADRSuff | 1 |
| CAS Number | 51811-82-6 |
| Storage Temperature | room temp |
| Flash Point | Not applicable |
| GHS Categories | NH |
| GHS Hazard Codes | NH |
| GHS Hazard Statements | NH |
| GHS Pictograms | - |
| GHS Precaution Codes | - |
| GHS Precaution Statements | Wear protective gloves/ eye protection/ face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. |
| GHS Signal Words | - |
| Hazard Symbols | Xn |
| Hazard Symbols Descriptions | Harmful |
| MDL Number | MFCD00081642 |
| Melting Point | 300 C (lit.) |
| Molecular Formula | C14H14ClN3S |
| Molecular Weight | 291.8 |
| Net Weight | 5 |
| R-Phrases | 22-41 |
| S-Phrases | 26-39 |
| Synonyms | Azure mixture sicc. Giemsa stain |
| Tariff Number | 32129000000 |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=G5637brand=SIGMA |
| InChI | 1S/C14H13N3S.ClH/c1-17(2)10-4-6-12-14(8-10)18-13-7-9(15)3-5-11(13)16-12;/h3-8,15H,1-2H3;1H |
| Quality Level | 200 |
| grade | certified by the Biological Stain Commission |
| SMILES string | [Cl-].CN(C)c1ccc2N=C3C=CC(=[NH2+])C=C3Sc2c1 |
| InChI key | NALREUIWICQLPS-UHFFFAOYSA-N |
| form | powder or crystals |
| mp | 300 C (lit.) |
| storage temp. | room temp |
| Application(s) | diagnostic assay manufacturinghematologyhistology |
| solubility | ethanol: 1 mg/mL, blue to very deep blue |
| Absorption | >=0.6 at 647-653 nm in methanol at 0.005 g/L |
Description
Giemsa Stain, Certified