01904 488599
Hydrocortisone Suitable For Cell Cultur
From £187.88 per (ex VAT)
Hydrocortisone Suitable For Cell Cultur
| Product Code | H0888-5G |
|---|---|
| Unit of Measure | 1X5GR |
| CAS Number | 50-23-7 |
| MDL NUMBER | MFCD00011654 |
| EMPIRICAL FORMULA | C21H3O5 |
| Molecular Weight | 362.46 |
| Synonyms | 11Beta,17Alpha,21-Trihydroxypregn-4-Ene-3,20-Dione; 17-Hydroxycorticosterone; 4-Pregnene-11Beta,17Alpha,21-Triol-3,20-Dione; Cortisol; Kendall'S Compound F; Reichstein'S Substance M |
| Brand | SIGMA-ALDRICH |
Tiered Pricing - H0888-5G
| Qty | Discount | Price |
|---|---|---|
| 4+ | 13% | £212.28 |
| 12+ | 15% | £207.40 |
| 36+ | 17% | £202.52 |
| 72+ | 23% | £187.88 |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12352200 |
| ADRSuff | 1 |
| CAS Number | 50-23-7 |
| Storage Temperature | room temp |
| EINECSNo | 200-020-1 |
| GHS Categories | Repr. 2 |
| GHS Hazard Codes | H361 |
| GHS Hazard Statements | Suspected of damaging fertility or the unborn child. |
| GHS Pictograms | GHS08 |
| GHS Precaution Codes | P280 |
| GHS Precaution Statements | Use personal protective equipment as required. |
| GHS Signal Words | Warning |
| Hazard Symbols | Xn |
| Hazard Symbols Descriptions | Harmful |
| MDL Number | MFCD00011654 |
| Melting Point | 211-214 C (lit.) |
| Molecular Formula | C21H3O5 |
| Molecular Weight | 362.46 |
| Net Weight | 5 |
| R-Phrases | 63 |
| RTECSNo | GM8925000 |
| S-Phrases | 36/37 |
| Synonyms | 11beta,17alpha,21-Trihydroxypregn-4-ene-3,20-dione; 17-Hydroxycorticosterone; 4-Pregnene-11beta,17alpha,21-triol-3,20-dione; Cortisol; Kendall's compound F; Reichstein's substance M |
| Tariff Number | 29372100000 |
| Quality Level | 200 |
| biological source | plant (wild yam) |
| product line | BioReagent |
| Assay | >=98% |
| storage temp. | room temp |
| shipped in | ambient |
| InChI | 1S/C21H30O5/c1-19-7-5-13(23)9-12(19)3-4-14-15-6-8-21(26,17(25)11-22)20(15,2)10-16(24)18(14)19/h9,14-16,18,22,24,26H,3-8,10-11H2,1-2H3/t14-,15-,16-,18+,19-,20-,21-/m0/s1 |
| form | powder |
| mp | 211-214 C (lit.) |
| SMILES string | [H][C@@]12CCC3=CC(=O)CC[C@]3(C)[C@@]1([H])[C@@H](O)C[C@@]4(C)[C@@]2([H])CC[C@]4(O)C(=O)CO |
| technique(s) | cell culture | mammalian: suitable |
| Gene Information | human ... ABCB1(5243), CYP3A4(1576), NR3C1(2908), SERPINA6(866)mouse ... Abcb1a(18671), Abcb1b(18669), Ifng(15978), Nos2(18126)rat ... Ar(24208), Nr3c1(24413) |
| solubility | chloroform/ethanol (1:1): 50 mg/mL, clear, colorless to very faintly yellow |
| InChI key | JYGXADMDTFJGBT-VWUMJDOOSA-N |
Description
Hydrocortisone Suitable For Cell Cultur