01904 488599
IMIDACLOPRID PESTANAL.
From £62.83 per (ex VAT)
Imidacloprid, PESTANAL(R), analytical standard
| Product Code | 37894-100MG |
|---|---|
| Unit of Measure | 1X100MG |
| CAS Number | 138261-41-3 |
| MDL NUMBER | MFCD00468059 |
| EMPIRICAL FORMULA | C9HClN5O2 |
| Molecular Weight | 255.66 |
| Brand | SUPELCO |
Tiered Pricing - 37894-100MG
| Qty | Discount | Price |
|---|---|---|
| 4+ | 8% | £65.69 |
| 12+ | 10% | £64.26 |
| 36+ | 12% | £62.83 |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 41116107 |
| ADRSuff | 1 |
| CAS Number | 138261-41-3 |
| ADR Not Allowed by Post | X |
| ADR Number of Danger | 90 |
| Flash Point | Not applicable |
| GHS Categories | Acute Tox. 4,Aquatic Acute 1,Aquatic Chronic 1 |
| GHS Hazard Codes | H302-H400-H410 |
| GHS Hazard Statements | Harmful if swallowed. Very toxic to aquatic life. Very toxic to aquatic life with long lasting effects. |
| GHS Pictograms | GHS07,GHS09 |
| GHS Precaution Codes | P301 + P312 + P330 |
| GHS Precaution Statements | Avoid release to the environment. Dispose of contents/ container to an approved waste disposal plant. |
| GHS Signal Words | Warning |
| Hazard Symbols | Xn |
| Hazard Symbols Descriptions | Harmful |
| MDL Number | MFCD00468059 |
| Melting Point | 140-146 C |
| Molecular Formula | C9HClN5O2 |
| Molecular Weight | 255.66 |
| Net Weight | 100 |
| R-Phrases | 22 |
| RTECSNo | NJ0560000 |
| Tariff Number | 29333999900 |
| Technical Name | IMIDACLOPRID |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=37894brand=SIAL |
| shelf life | limited shelf life, expiry date on the label |
| mp | 140-146 C |
| format | neat |
| technique(s) | gas chromatography (GC): suitable |
| grade | analytical standard |
| SMILES string | [O-][N+](=O)NC1=NCCN1Cc2ccc(Cl)nc2 |
| Quality Level | 100 |
| Application(s) | agricultureenvironmental |
| InChI | 1S/C9H10ClN5O2/c10-8-2-1-7(5-12-8)6-14-4-3-11-9(14)13-15(16)17/h1-2,5H,3-4,6H2,(H,11,13) |
| product line | PESTANAL(R) |
| suitability | passes test for identity (NMR) |
| InChI key | YWTYJOPNNQFBPC-UHFFFAOYSA-N |
Description
Imidacloprid, PESTANAL(R), analytical standard