01904 488599
Kresoxim-Methyl Pestanal.
From £115.00 per (ex VAT)
Kresoxim-Methyl Pestanal.
| Product Code | 37899-100MG |
|---|---|
| Unit of Measure | 1X100MG |
| CAS Number | 143390-89-0 |
| MDL NUMBER | MFCD00871777 |
| EMPIRICAL FORMULA | C18H19NO4 |
| Molecular Weight | 313.35 |
| Synonyms | Methyl (E)-Alpha-(Methoxyimino)-2-(2-Methylphenoxymethyl)Phenylacetate; Kresoxim-Methyl |
| Brand | SUPELCO |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 41116107 |
| ADRSuff | 1 |
| CAS Number | 143390-89-0 |
| ADR Number of Danger | 90 |
| Flash Point | Not applicable |
| GHS Categories | Carc. 2,Aquatic Acute 1,Aquatic Chronic 1 |
| GHS Hazard Codes | H351-H400-H410 |
| GHS Hazard Statements | Suspected of causing cancer. Very toxic to aquatic life. Very toxic to aquatic life with long lasting effects. |
| GHS Pictograms | GHS08,GHS09 |
| GHS Precaution Codes | P273 - P281 - P501 |
| GHS Precaution Statements | Avoid release to the environment. Use personal protective equipment as required. Dispose of contents/ container to an approved waste disposal plant. |
| GHS Signal Words | Warning |
| Hazard Symbols | Xn,N |
| Hazard Symbols Descriptions | Harmful, Dangerous for the environment |
| MDL Number | MFCD00871777 |
| Melting Point | 97-102 C |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.35 |
| Net Weight | 100 |
| R-Phrases | 40-50/53 |
| S-Phrases | 36/37-60-61 |
| Synonyms | Methyl (E)-alpha-(methoxyimino)-2-(2-methylphenoxymethyl)phenylacetate; Kresoxim-methyl |
| Tariff Number | 29280090900 |
| Technical Name | KRESOXIM-METHYL |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=37899brand=SIAL |
| InChI key | ZOTBXTZVPHCKPN-HTXNQAPBSA-N |
| shelf life | limited shelf life, expiry date on the label |
| InChI | 1S/C18H19NO4/c1-13-8-4-7-11-16(13)23-12-14-9-5-6-10-15(14)17(19-22-3)18(20)21-2/h4-11H,12H2,1-3H3/b19-17+ |
| Application(s) | agriculturecleaning productscosmeticsenvironmentalfood and beveragespersonal care |
| format | neat |
| mp | 97-102 C |
| technique(s) | gas chromatography (GC): suitable |
| grade | analytical standard |
| Quality Level | 100 |
| SMILES string | CON=C(C(=O)OC)c1ccccc1COc2ccccc2C |
| product line | PESTANAL(R) |
| suitability | passes test for identity (NMR) |
Description
Kresoxim-Methyl Pestanal.