01904 488599
Lindan Pestanal
From £55.90 per (ex VAT)
Lindan Pestanal
| Product Code | 45548-250MG |
|---|---|
| Unit of Measure | 1X250MG |
| CAS Number | 58-89-9 |
| MDL NUMBER | MFCD00135947 |
| EMPIRICAL FORMULA | C6H6Cl6 |
| Molecular Weight | 290.83 |
| Synonyms | Gamma-Bhc; 1Alpha,2Alpha,3Beta,4Alpha,5Alpha,6Beta-Hexachlorocyclohexane |
| Brand | SUPELCO |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 41116107 |
| ADRSuff | CN |
| CAS Number | 58-89-9 |
| ADR Hazard Labels | 6.1 |
| ADR Not Allowed by Post | X |
| ADR Number of Danger | 66 |
| ADR Packing Group | 3 |
| ADR Primary Hazard Class | 6.1 |
| ADR Proper Shipping Name | Toxic solid, organic, n.o.s. |
| ADRNo | 2811 |
| EINECSNo | 200-401-2 |
| Flash Point | Not applicable |
| GHS Categories | Acute Tox. 3,Acute Tox. 4,Acute Tox. 4,,STOT RE 2,Aquatic Acute 1,Aquatic Chronic 1 |
| GHS Hazard Codes | H301-H312-H332-H362-H373-H400-H410 |
| GHS Pictograms | GHS06,GHS08,GHS09 |
| GHS Precaution Codes | P201 - P260 - P263 - P273 - P301 + P310 + P330 - P302 + P352 + P312 |
| GHS Signal Words | Danger |
| Hazard Symbols | T,N |
| Hazard Symbols Descriptions | Toxic, Dangerous for the environment |
| MDL Number | MFCD00135947 |
| GHS Hazard Statements | Toxic if swallowed. Harmful in contact with skin. Harmful if inhaled. May cause harm to breast-fed children. May cause damage to organs through prolonged or repeated exposure. Very toxic to aquatic life. Very toxic to aquatic life with long lasting effect |
| GHS Precaution Statements | Avoid contact during pregnancy/ while nursing. Avoid release to the environment. Wear protective gloves/ protective clothing. IF SWALLOWED: Immediately call a POISON CENTER or doctor/ physician. Dispose of contents/ container to an approved waste disposal |
| Melting Point | 113-115 C (lit.) |
| Molecular Formula | C6H6Cl6 |
| Molecular Weight | 290.83 |
| Net Weight | 250 |
| R-Phrases | 20/21-25-48/22-50/53-64 |
| RTECSNo | GV4900000 |
| S-Phrases | 36/37-45-60-61 |
| Synonyms | gamma-BHC; 1alpha,2alpha,3beta,4alpha,5alpha,6beta-Hexachlorocyclohexane |
| Tariff Number | 29038100000 |
| Technical Name | GAMMA-HEXACHLOROCYCLOHEXANE |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=45548brand=SIAL |
| InChI key | JLYXXMFPNIAWKQ-GNIYUCBRSA-N |
| shelf life | limited shelf life, expiry date on the label |
| Application(s) | agriculturecleaning productscosmeticsenvironmentalfood and beveragespersonal care |
| InChI | 1S/C6H6Cl6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-6H/t1-,2-,3-,4+,5+,6+ |
| mp | 113-115 C (lit.) |
| format | neat |
| SMILES string | Cl[C@H]1[C@H](Cl)[C@H](Cl)[C@@H](Cl)[C@H](Cl)[C@@H]1Cl |
| technique(s) | gas chromatography (GC): suitable |
| grade | analytical standard |
| Quality Level | 100 |
| product line | PESTANAL(R) |
| solubility | H2O: 8.35 g/L at 25 C |
Description
Lindan Pestanal