01904 488599
Melting Point Standard 47-490C
From £42.10 per (ex VAT)
Melting Point Standard 47-490C
| Product Code | 50296-5G |
|---|---|
| Unit of Measure | 1X5GR |
| CAS Number | 119-61-9 |
| MDL NUMBER | MFCD00003076 |
| EMPIRICAL FORMULA | C13HO |
| Molecular Weight | 182.22 |
| Synonyms | Benzophenone; Diphenyl Ketone; Diphenylmethanone; Nsc 8077 |
| Brand | SUPELCO |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 20121904 |
| ADRSuff | 1 |
| CAS Number | 119-61-9 |
| ADR Not Allowed by Post | X |
| ADR Number of Danger | 90 |
| Boiling Point | 305 C (lit.) |
| EINECSNo | 204-337-6 |
| Flash Point | 138 C - closed cup |
| GHS Categories | Aquatic Acute 1,Aquatic Chronic 1 |
| GHS Hazard Codes | H400-H410 |
| GHS Hazard Statements | Very toxic to aquatic life. Very toxic to aquatic life with long lasting effects. |
| GHS Pictograms | GHS09 |
| GHS Precaution Codes | - |
| GHS Precaution Statements | Avoid release to the environment. Dispose of contents/ container to an approved waste disposal plant. |
| GHS Signal Words | Warning |
| Hazard Symbols | Xn,N |
| Hazard Symbols Descriptions | Harmful, Dangerous for the environment |
| MDL Number | MFCD00003076 |
| Melting Point | 47-49 C (+/-0.3C); 47-51 C (lit.) |
| Molecular Formula | C13HO |
| Molecular Weight | 182.22 |
| Net Weight | 5 |
| R-Phrases | 40-50/53 |
| RTECSNo | DI9950000 |
| S-Phrases | 60-61 |
| Synonyms | Benzophenone; Diphenyl ketone; Diphenylmethanone; NSC 8077 |
| Tariff Number | 29143900900 |
| Technical Name | BENZOPHENONE |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=50296brand=SIAL |
| SMILES string | O=C(C1=CC=CC=C1)C2=CC=CC=C2 |
| shelf life | limited shelf life, expiry date on the label |
| bp | 305 C (lit.) |
| format | neat |
| grade | analytical standard |
| Quality Level | 100 |
| mp | 47-49 C (+/-0.3C) |
| Application(s) | food and beveragespharmaceutical |
| vapor pressure | 1 mmHg ( 108 C) |
| InChI | 1S/C13H10O/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H |
| InChI key | RWCCWEUUXYIKHB-UHFFFAOYSA-N |
Description
Melting Point Standard 47-490C