01904 488599
Methyl Jasmonate, >=98%, Stabilized, Fg
From £69.40 per (ex VAT)
Methyl Jasmonate, >=98%, Stabilized, Fg
| Product Code | W341002-SAMPLE-K |
|---|---|
| Unit of Measure | 1XEA |
| CAS Number | 39924-52-2 |
| MDL NUMBER | MFCD00036656 |
| EMPIRICAL FORMULA | C13H2O3 |
| Molecular Weight | 224.3 |
| Synonyms | 3-Oxo-2-(2-Pentenyl)Cyclopentaneacetic Acid, Methyl Ester; Methyl 3-Oxo-2-(2-Pentenyl)Cyclopentaneacetate |
| Brand | SIGMA-ALDRICH |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12164502 |
| ADRSuff | 1 |
| CAS Number | 39924-52-2 |
| Boiling Point | 110 C/0.2 mmHg (lit.) |
| Density | 1.03 g/mL at 25 C (lit.) |
| EINECSNo | 254-705-5 |
| Flash Point | > 113 C - closed cup |
| GHS Categories | Acute Tox. 4,Eye Irrit. 2 |
| GHS Hazard Codes | H302-H319 |
| GHS Hazard Statements | Harmful if swallowed. Causes serious eye irritation. |
| GHS Pictograms | GHS07 |
| GHS Precaution Codes | P305 + P351 + P338 |
| GHS Precaution Statements | IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. |
| GHS Signal Words | Warning |
| Hazard Symbols | Xn |
| Hazard Symbols Descriptions | Harmful |
| MDL Number | MFCD00036656 |
| Molecular Formula | C13H2O3 |
| Molecular Weight | 224.3 |
| Net Weight | 10 |
| R-Phrases | 22-36-52/53 |
| S-Phrases | 26-61 |
| Synonyms | 3-Oxo-2-(2-pentenyl)cyclopentaneacetic acid, methyl ester; Methyl 3-oxo-2-(2-pentenyl)cyclopentaneacetate |
| Tariff Number | 29183000900 |
| Application(s) | flavors and fragrances |
| Quality Level | 400 |
| bp | 110 C/0.2 mmHg (lit.) |
| food allergen | no known allergens |
| biological source | synthetic |
| grade | FG |
| Assay | >=98% |
| reg. compliance | EU Regulation 1223/2009 |
| refractive index | n20/D 1.474 (lit.) |
| contains | synthetic alpha-tocopherol as stabilizer |
| fragrance allergen | no known allergens |
| Documentation | see Safety & Documentation for available documents |
| agency | follows IFRA guidelines |
| SMILES string | CCC=CCC1C(CCC1=O)CC(=O)OC |
| InChI | 1S/C13H20O3/c1-3-4-5-6-11-10(7-8-12(11)14)9-13(15)16-2/h4-5,10-11H,3,6-9H2,1-2H3/b5-4+ |
| InChI key | GEWDNTWNSAZUDX-SNAWJCMRSA-N |
| Organoleptic | fresh; green; jasmine; floral; fruity; sweet |
Description
Methyl Jasmonate, >=98%, Stabilized, Fg