01904 488599
N-Boc-4-Oxo-L-Proline Methyl Ester, 97%
From £42.31 per (ex VAT)
N-Boc-4-Oxo-L-Proline Methyl Ester, 97%
| Product Code | 702498-1G |
|---|---|
| Unit of Measure | 1X1GR |
| CAS Number | 102195-80-2 |
| MDL NUMBER | MFCD01861778 |
| EMPIRICAL FORMULA | C11H17NO5 |
| Molecular Weight | 243.26 |
| Synonyms | (2S)-4-Oxo-1-(Tert-Butoxycarbonyl)Pyrrolidine-2-Carboxylic Acid Methyl Ester; 1-Tert-Butyl 2-Methyl (2S)-4-Oxopyrrolidine-1,2-Dicarboxylate; Tert-Butyl (2S)-2-(Methoxycarbonyl)-4-Oxopyrrolidine-1-Carboxylate |
| Brand | SIGMA-ALDRICH |
Tiered Pricing - 702498-1G
| Qty | Discount | Price |
|---|---|---|
| 4+ | 8% | £47.47 |
| 12+ | 10% | £46.44 |
| 36+ | 12% | £45.41 |
| 72+ | 18% | £42.31 |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12352000 |
| ADRSuff | 1 |
| CAS Number | 102195-80-2 |
| Storage Temperature | -20C |
| Flash Point | > 110 C |
| GHS Categories | Acute Tox. 4,Acute Tox. 4,Eye Dam. 1 |
| GHS Hazard Codes | H302-H312-H318 |
| GHS Hazard Statements | Harmful if swallowed. Harmful in contact with skin. Causes serious eye damage. |
| GHS Pictograms | GHS05,GHS07 |
| GHS Precaution Codes | P280 - P305 + P351 + P338 |
| GHS Precaution Statements | Wear protective gloves/ eye protection/ face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. |
| GHS Signal Words | Danger |
| Hazard Symbols | Xn |
| Hazard Symbols Descriptions | Harmful |
| MDL Number | MFCD01861778 |
| Melting Point | 42-46 C |
| Molecular Formula | C11H17NO5 |
| Molecular Weight | 243.26 |
| Net Weight | 1 |
| Purity Grade | 0.97 |
| R-Phrases | 20/21/22-41 |
| S-Phrases | 26-36/37-39 |
| Synonyms | (2S)-4-Oxo-1-(tert-butoxycarbonyl)pyrrolidine-2-carboxylic acid methyl ester; 1-tert-Butyl 2-methyl (2S)-4-oxopyrrolidine-1,2-dicarboxylate; tert-Butyl (2S)-2-(methoxycarbonyl)-4-oxopyrrolidine-1-carboxylate |
| Tariff Number | 29339980900 |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=702498brand=ALDRICH |
| Assay | 97% |
| optical activity | [alpha]22/D +14.0, c = 1 in chloroform |
| mp | 42-46 C |
| storage temp. | -20C |
| Quality Level | 100 |
| InChI | 1S/C11H17NO5/c1-11(2,3)17-10(15)12-6-7(13)5-8(12)9(14)16-4/h8H,5-6H2,1-4H3/t8-/m0/s1 |
| InChI key | UPBHYYJZVWZCOZ-QMMMGPOBSA-N |
| SMILES string | COC(=O)[C@@H]1CC(=O)CN1C(=O)OC(C)(C)C |
| form | powder |
Description
N-Boc-4-Oxo-L-Proline Methyl Ester, 97%