01904 488599
N-Methyl-N-(Trimethylsilyl)Trifluoroacet
From £370.48 per (ex VAT)
N-Methyl-N-(Trimethylsilyl)Trifluoroacet
| Product Code | 69479-10X1ML |
|---|---|
| Unit of Measure | 10X1ML |
| CAS Number | 24589-78-4 |
| MDL NUMBER | MFCD00000411 |
| EMPIRICAL FORMULA | C6H12F3NOSi |
| Molecular Weight | 199.25 |
| Synonyms | N-Trimethylsilyl-N-Methyl Trifluoroacetamide; Mstfa |
| Brand | SUPELCO |
Tiered Pricing - 69479-10X1ML
| Qty | Discount | Price |
|---|---|---|
| 4+ | 8% | £387.32 |
| 12+ | 10% | £378.90 |
| 36+ | 12% | £370.48 |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12000000 |
| ADRSuff | C |
| CAS Number | 24589-78-4 |
| ADR Hazard Labels | 3 |
| ADR Not Allowed by Post | X |
| ADR Number of Danger | 30 |
| ADR Packing Group | 3 |
| ADR Primary Hazard Class | 3 |
| ADR Proper Shipping Name | Flammable liquid, n.o.s. |
| ADRNo | 1993 |
| Boiling Point | 130-132 C (lit.) |
| Storage Temperature | 2-8C |
| Density | 1.075 g/mL at 25 C (lit.) |
| EINECSNo | 246-331-6 |
| Flash Point | 25 C - closed cup |
| GHS Categories | Flam. Liq. 3,Skin Irrit. 2,Eye Irrit. 2,STOT SE 3 |
| GHS Hazard Codes | H226-H315-H319-H335 |
| GHS Hazard Statements | Flammable liquid and vapour. Causes skin irritation. Causes serious eye irritation. May cause respiratory irritation. |
| GHS Pictograms | GHS02,GHS07 |
| GHS Precaution Codes | P261 - P305 + P351 + P338 |
| GHS Precaution Statements | Avoid breathing dust/ fume/ gas/ mist/ vapours/ spray. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. |
| GHS Signal Words | Warning |
| Hazard Symbols | Xi |
| Hazard Symbols Descriptions | Irritant |
| MDL Number | MFCD00000411 |
| Molecular Formula | C6H12F3NOSi |
| Molecular Weight | 199.25 |
| Net Weight | 10.79 |
| R-Phrases | 10-36/37/38 |
| RTECSNo | AC9800000 |
| S-Phrases | 26-36 |
| Synonyms | N-Trimethylsilyl-N-methyl trifluoroacetamide; MSTFA |
| Tariff Number | 29319000900 |
| Technical Name | N-METHYL-N-TRIMETHYLSILYLTRIFLUOROACETAMIDE |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=69479brand=SIAL |
| bp | 130-132 C (lit.) |
| quality | LiChropur(TM) |
| InChI | 1S/C6H12F3NOSi/c1-10(12(2,3)4)5(11)6(7,8)9/h1-4H3 |
| Assay | >=98.5% (GC) |
| form | liquid |
| vapor pressure | 8.8 mmHg ( 27 C) |
| technique(s) | gas chromatography (GC): suitable |
| grade | for GC derivatization |
| InChI key | MSPCIZMDDUQPGJ-UHFFFAOYSA-N |
| Quality Level | 100 |
| vapor density | >1 (vs air) |
| reaction suitability | reagent type: derivatization reagentreaction type: Silylations |
| storage temp. | 2-8C |
| refractive index | n20/D 1.380 |
| SMILES string | CN(C(=O)C(F)(F)F)[Si](C)(C)C |
Description
N-Methyl-N-(Trimethylsilyl)Trifluoroacet