01904 488599
Naphthol As-Bi Phosphate, Technical Grad
From £91.44 per (ex VAT)
Naphthol As-Bi Phosphate, Technical Grad
| Product Code | N2125-500MG |
|---|---|
| Unit of Measure | 1X500MG |
| CAS Number | 1919-91-1 |
| MDL NUMBER | MFCD00004058 |
| EMPIRICAL FORMULA | C18H15BrNO6P |
| Molecular Weight | 452.19 |
| Synonyms | 7-Bromo-3-Hydroxy-2-Naphthoic-O-Anisidide Phosphate |
| Brand | SIGMA-ALDRICH |
Tiered Pricing - N2125-500MG
| Qty | Discount | Price |
|---|---|---|
| 4+ | 18% | £104.14 |
| 12+ | 20% | £101.60 |
| 36+ | 22% | £99.06 |
| 72+ | 28% | £91.44 |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12171500 |
| ADRSuff | 1 |
| CAS Number | 1919-91-1 |
| Storage Temperature | -20C |
| EINECSNo | 217-645-0 |
| Flash Point | Not applicable |
| GHS Categories | Skin Irrit. 2,Eye Irrit. 2,STOT SE 3 |
| GHS Hazard Codes | H315-H319-H335 |
| GHS Hazard Statements | Causes skin irritation. Causes serious eye irritation. May cause respiratory irritation. |
| GHS Pictograms | GHS07 |
| GHS Precaution Codes | P261 - P305 + P351 + P338 |
| GHS Precaution Statements | Avoid breathing dust/ fume/ gas/ mist/ vapours/ spray. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. |
| GHS Signal Words | Warning |
| Hazard Symbols | Xi |
| Hazard Symbols Descriptions | Irritant |
| MDL Number | MFCD00004058 |
| Molecular Formula | C18H15BrNO6P |
| Molecular Weight | 452.19 |
| Net Weight | 500 |
| R-Phrases | 36/37/38 |
| S-Phrases | 26-36 |
| Synonyms | 7-Bromo-3-hydroxy-2-naphthoic-o-anisidide phosphate |
| Tariff Number | 29242970990 |
| Quality Level | 200 |
| InChI | 1S/C18H15BrNO6P/c1-25-16-5-3-2-4-15(16)20-18(21)14-9-12-8-13(19)7-6-11(12)10-17(14)26-27(22,23)24/h2-10H,1H3,(H,20,21)(H2,22,23,24) |
| form | powder |
| Application(s) | diagnostic assay manufacturinghematologyhistology |
| solubility | methanol: 50 mg/mL |
| InChI key | HUXIAXQSTATULQ-UHFFFAOYSA-N |
| Assay | 98% (HPLC) |
| storage temp. | -20C |
| SMILES string | COc1ccccc1NC(=O)c2cc3cc(Br)ccc3cc2OP(O)(O)=O |
Description
Naphthol As-Bi Phosphate, Technical Grad