01904 488599
Phenol Chloroform Isoamyl Alcohol M
From £88.92 per (ex VAT)
Phenol Chloroform Isoamyl Alcohol M
| Product Code | 77618-100ML |
|---|---|
| Unit of Measure | 1X100ML |
| CAS Number | 136112-00-0 |
| MDL NUMBER | MFCD00133763 |
| Brand | SIGMA-ALDRICH |
Tiered Pricing - 77618-100ML
| Qty | Discount | Price |
|---|---|---|
| 4+ | 5% | £89.87 |
| 12+ | 6% | £88.92 |
Properties
| Property | Value |
|---|---|
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=77618brand=SIGMA |
| impurities | phosphatases, none detected |
| form | liquid |
| InChI key | ZYWFEOZQIUMEGL-UHFFFAOYSA-N |
| product line | BioUltra |
| Quality Level | 100 |
| Absorption | cut-off at 360 nm |
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12352200 |
| ADRSuff | BN |
| CAS Number | 136112-00-0 |
| ADR Hazard Labels | 6.1 |
| ADR Number of Danger | 60 |
| ADR Packing Group | 2 |
| ADR Primary Hazard Class | 6.1 |
| ADR Proper Shipping Name | Toxic liquid, organic, n.o.s. |
| ADRNo | 2810 |
| Storage Temperature | 2-8C |
| Density | 1.29 g/mL at 20 C |
| Flash Point | Not applicable |
| GHS Categories | Acute Tox. 3,Acute Tox. 4,Skin Corr. 1B,Acute Tox. 4,STOT SE 3,Muta. 2,Carc. 2,Repr. 2,STOT RE 1,Aquatic Chronic 2 |
| GHS Hazard Codes | H301-H312-H314-H332-H336-H341-H351-H361d-H372-H411 |
| GHS Hazard Statements | Toxic if swallowed. Harmful in contact with skin. Causes severe skin burns and eye damage. Harmful if inhaled. May cause drowsiness or dizziness. Suspected of causing genetic defects. Suspected of causing cancer. Suspected of damaging the unborn child. Ca |
| GHS Pictograms | GHS06,GHS08,GHS05,GHS09 |
| GHS Precaution Codes | P201 - P261 - P301 + P310 + P330 - P303 + P361 + P353 - P304 + P340 + P310 - P305 + P351 + P338 |
| GHS Signal Words | Danger |
| Hazard Symbols | T |
| Hazard Symbols Descriptions | Toxic |
| MDL Number | MFCD00133763 |
| Net Weight | 129 |
| R-Phrases | 63-23/24/25-34-40-48/20/21/22-68 |
| S-Phrases | 26-36/37/39-45 |
| Tariff Number | 38249992990 |
| Technical Name | PHENOL, CHLOROFORM, ISOAMYL ALCOHOL SOLUTION |
| GHS Precaution Statements | Do not breathe dust/ fume/ gas/ mist/ vapours/ spray. Wear protective gloves/ protective clothing/ eye protection/ face protection. Wear respiratory protection. IF SWALLOWED: Immediately call a POISON CENTER or doctor/ physician. IF IN EYES: Rinse cautiou |
| storage temp. | 2-8C |
| SMILES string | ClC(Cl)Cl.CC(C)CCO.Oc1ccccc1 |
| grade | for molecular biology |
| InChI | 1S/C6H6O.C5H12O.CHCl3/c7-6-4-2-1-3-5-6;1-5(2)3-4-6;2-1(3)4/h1-5,7H;5-6H,3-4H2,1-2H3;1H |
| pH | 7.7-8.3(H2O-phase, after extraction with H2O, 1:1) |
Description
Phenol Chloroform Isoamyl Alcohol M