01904 488599
Safranin O
From £251.49 per (ex VAT)
Safranin O
| Product Code | S2255-100G |
|---|---|
| Unit of Measure | 1X100GR |
| CAS Number | 477-73-6 |
| MDL NUMBER | MFCD00011759 |
| EMPIRICAL FORMULA | C2H19ClN4 |
| Molecular Weight | 350.84 |
| Synonyms | Basic Red 2; Cotton Red; Gossypimine; Safranin T; Safranin Y Or A |
| Brand | SIGMA-ALDRICH |
Tiered Pricing - S2255-100G
| Qty | Discount | Price |
|---|---|---|
| 4+ | 13% | £263.61 |
| 12+ | 15% | £257.55 |
| 36+ | 17% | £251.49 |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12171500 |
| ADRSuff | 1 |
| CAS Number | 477-73-6 |
| Storage Temperature | room temp |
| EINECSNo | 207-518-8 |
| GHS Categories | Eye Dam. 1 |
| GHS Hazard Codes | H318 |
| GHS Hazard Statements | Causes serious eye damage. |
| GHS Pictograms | GHS05 |
| GHS Precaution Codes | P280 - P305 + P351 + P338 |
| GHS Precaution Statements | Wear protective gloves/ eye protection/ face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. |
| GHS Signal Words | Danger |
| Hazard Symbols | Xi |
| Hazard Symbols Descriptions | Irritant |
| MDL Number | MFCD00011759 |
| Molecular Formula | C2H19ClN4 |
| Molecular Weight | 350.84 |
| Net Weight | 100 |
| R-Phrases | 41 |
| RTECSNo | SG1623000 |
| S-Phrases | 26-39 |
| Synonyms | Basic Red 2; Cotton Red; Gossypimine; Safranin T; Safranin Y or A |
| Tariff Number | 32129000000 |
| Quality Level | 200 |
| epsilonmax | 1250-1650 at 530-534 nm in 50% ethanol |
| InChI | 1S/C20H18N4.ClH/c1-12-8-17-19(10-15(12)21)24(14-6-4-3-5-7-14)20-11-16(22)13(2)9-18(20)23-17;/h3-11H,1-2H3,(H3,21,22);1H |
| form | powder |
| Application(s) | diagnostic assay manufacturinghematologyhistology |
| solubility | water: 1 mg/mL, clear, dark red to very dark red and red purple |
| Composition | Dye content, >=85% |
| SMILES string | [Cl-].Cc1cc2nc3cc(C)c(N)cc3[n+](-c4ccccc4)c2cc1N |
| storage temp. | room temp |
| InChI key | OARRHUQTFTUEOS-UHFFFAOYSA-N |
Description
Safranin O