01904 488599
Sodium Glycodeoxycholate Bioxtra, >= 97
From £330.88 per (ex VAT)
Sodium Glycodeoxycholate Bioxtra, >= 97
| Product Code | G9910-5G |
|---|---|
| Unit of Measure | 1X5GR |
| CAS Number | 16409-34-0 |
| MDL NUMBER | MFCD00036742 |
| EMPIRICAL FORMULA | C26H42NNaO5 |
| Molecular Weight | 471.61 |
| Synonyms | 3Alpha,12Alpha-Dihydroxy-5Beta-Cholan-24-Oic Acid N-(Carboxymethyl)Amide; Glycodeoxycholic Acid Sodium Salt; Glycodesoxycholic Acid; N-(3Alpha,12Alpha-Dihydroxy-24-Oxocholan-24-Yl)Glycine |
| Brand | SIGMA-ALDRICH |
Tiered Pricing - G9910-5G
| Qty | Discount | Price |
|---|---|---|
| 4+ | 8% | £345.92 |
| 12+ | 10% | £338.40 |
| 36+ | 12% | £330.88 |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12161900 |
| ADRSuff | 1 |
| CAS Number | 16409-34-0 |
| EINECSNo | 240-455-4 |
| Flash Point | Not applicable |
| GHS Categories | NH |
| GHS Hazard Codes | NH |
| GHS Hazard Statements | NH |
| GHS Pictograms | - |
| GHS Precaution Codes | - |
| GHS Precaution Statements | Avoid breathing dust/ fume/ gas/ mist/ vapours/ spray. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. |
| GHS Signal Words | - |
| Hazard Symbols | Xi |
| Hazard Symbols Descriptions | Irritant |
| MDL Number | MFCD00036742 |
| Molecular Formula | C26H42NNaO5 |
| Molecular Weight | 471.61 |
| Net Weight | 5 |
| R-Phrases | 36/37/38 |
| S-Phrases | 26-36 |
| Synonyms | 3alpha,12alpha-Dihydroxy-5beta-cholan-24-oic acid N-(carboxymethyl)amide; Glycodeoxycholic acid sodium salt; Glycodesoxycholic acid; N-(3alpha,12alpha-Dihydroxy-24-oxocholan-24-yl)glycine |
| Tariff Number | 29242970990 |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=G9910brand=SIGMA |
| InChI key | BMYWWGPEKRLDGW-ZXMGEDLUSA-N |
| SMILES string | [Na].[H][C@]12CC[C@@]3([H])[C@]4([H])CC[C@]([H])([C@H](C)CCC(=O)NCC(O)=O)[C@@]4(C)[C@@H](O)C[C@]3([H])[C@@]1(C)CC[C@@H](O)C2 |
| impurities | <=0.1% Insoluble matter |
| InChI | 1S/C26H43NO5.Na.H/c1-15(4-9-23(30)27-14-24(31)32)19-7-8-20-18-6-5-16-12-17(28)10-11-25(16,2)21(18)13-22(29)26(19,20)3;;/h15-22,28-29H,4-14H2,1-3H3,(H,27,30)(H,31,32);;/t15-,16-,17-,18+,19-,20+,21+,22+,25+,26-;;/m1../s1 |
| Quality Level | 200 |
| cation traces | Al: <=0.0005% |
| Anion Traces | sulfate (SO42-): <=0.05% |
| mol wt | 471.61 g/mol |
| description | anionic |
| Assay | >=97% (HPLC) |
| CMC | 2.1 mM |
| solubility | H2O: 0.1 M, clear to slightly hazy, colorless to almost colorless |
| product line | BioXtra |
Description
Sodium Glycodeoxycholate Bioxtra, >= 97