01904 488599
Sunset Yellow Fcf
From £33.70 per (ex VAT)
Sunset Yellow Fcf
| Product Code | 465224-25G |
|---|---|
| Unit of Measure | 1X25GR |
| CAS Number | 2783-94-0 |
| MDL NUMBER | MFCD00036437 |
| EMPIRICAL FORMULA | C16HN2Na2O7S2 |
| Molecular Weight | 452.37 |
| Synonyms | Food Yellow 3; Orange Yellow S |
| Brand | SIGMA-ALDRICH |
Tiered Pricing - 465224-25G
| Qty | Discount | Price |
|---|---|---|
| 4+ | 18% | £38.38 |
| 12+ | 20% | £37.44 |
| 36+ | 22% | £36.50 |
| 72+ | 28% | £33.70 |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12171500 |
| ADRSuff | 1 |
| CAS Number | 2783-94-0 |
| Storage Temperature | room temp |
| Density | 0.617 g/cm3 at 26 C |
| EINECSNo | 220-491-7 |
| Flash Point | Not applicable |
| GHS Categories | NH |
| GHS Hazard Codes | NH |
| GHS Hazard Statements | NH |
| GHS Pictograms | - |
| GHS Precaution Codes | - |
| GHS Signal Words | - |
| Hazard Symbols | Xi |
| Hazard Symbols Descriptions | Irritant |
| MDL Number | MFCD00036437 |
| Melting Point | >300 C (lit.) |
| Molecular Formula | C16HN2Na2O7S2 |
| Molecular Weight | 452.37 |
| Net Weight | 25 |
| R-Phrases | 36/37/38 |
| RTECSNo | QK2450000 |
| S-Phrases | 26-36 |
| Synonyms | Food Yellow 3; Orange Yellow S |
| GHS Precaution Statements | Avoid breathing dust/ fume/ gas/ mist/ vapours/ spray. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. |
| Tariff Number | 32129000000 |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=465224brand=ALDRICH |
| InChI | 1S/C16H12N2O7S2.2Na/c19-15-8-1-10-9-13(27(23,24)25)6-7-14(10)16(15)18-17-11-2-4-12(5-3-11)26(20,21)22;;/h1-9,19H,(H,20,21,22)(H,23,24,25);;/q;2*+1/p-2/b18-17+;; |
| Quality Level | 200 |
| lambdamax | 482 nm |
| storage temp. | room temp |
| Application(s) | diagnostic assay manufacturinghematologyhistology |
| Composition | Dye content, 90% |
| InChI key | OIQPTROHQCGFEF-QIKYXUGXSA-L |
| mp | >300 C (lit.) |
| SMILES string | [Na+].[Na+].Oc1ccc2cc(ccc2c1N=Nc3ccc(cc3)S([O-])(=O)=O)S([O-])(=O)=O |
| epsilon (extinction coefficient) | >=20000 at 479-485 nm in H2O |
| form | powder |
Description
Sunset Yellow Fcf