01904 488599
Testosterone Enanthate–Dea Schedule Iii
From £102.40 per (ex VAT)
Testosterone Enanthate–Dea Schedule Iii
| Product Code | T3006-1G |
|---|---|
| Unit of Measure | 1X1GR |
| CAS Number | 315-37-7 |
| MDL NUMBER | MFCD00055890 |
| EMPIRICAL FORMULA | C26H4O3 |
| Molecular Weight | 400.59 |
| Synonyms | (17Beta)-17-[(1-Oxoheptyl)Oxy]Androst-4-En-3-One; 17Beta-Hydroxy-4-Androsten-3-One 17-Enanthate; 4-Androsten-17Beta-Ol-3-One 17-Enanthate; Nsc 17591; Testosterone 17Beta-Heptanoate |
| Brand | SUPELCO |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 41116107 |
| ADRSuff | 1 |
| CAS Number | 315-37-7 |
| Storage Temperature | 2-8C |
| EINECSNo | 206-253-5 |
| Flash Point | Not applicable |
| GHS Categories | Acute Tox. 4,Carc. 1B,Repr. 2 |
| GHS Hazard Codes | H302-H350-H361 |
| GHS Hazard Statements | Harmful if swallowed. May cause cancer. Suspected of damaging fertility or the unborn child. |
| GHS Pictograms | GHS08,GHS07 |
| GHS Precaution Codes | P201 - P281 - P308 + P313 |
| GHS Precaution Statements | Obtain special instructions before use. Use personal protective equipment as required. IF exposed or concerned: Get medical advice/ attention. |
| GHS Signal Words | Danger |
| Hazard Symbols | T |
| Hazard Symbols Descriptions | Toxic |
| MDL Number | MFCD00055890 |
| Molecular Formula | C26H4O3 |
| Molecular Weight | 400.59 |
| Net Weight | 1 |
| R-Phrases | 45-63 |
| RTECSNo | XA3080000 |
| S-Phrases | 53-22-36/37/39-45 |
| Synonyms | (17beta)-17-[(1-Oxoheptyl)oxy]androst-4-en-3-one; 17beta-Hydroxy-4-androsten-3-one 17-enanthate; 4-Androsten-17beta-ol-3-one 17-enanthate; NSC 17591; Testosterone 17beta-heptanoate |
| Tariff Number | 29372900000 |
| drug control | USDEA Schedule III; Home Office Schedule 4.2; regulated under CDSA - not available from Sigma-Aldrich Canada |
| Quality Level | 200 |
| storage temp. | 2-8C |
| Application(s) | forensics and toxicologyveterinary |
| Gene Information | human ... AR(367) |
| technique(s) | HPLC: suitable |
| SMILES string | CCCCCCC(=O)O[C@H]1CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C |
| format | neat |
| InChI key | VOCBWIIFXDYGNZ-IXKNJLPQSA-N |
| InChI | 1S/C26H40O3/c1-4-5-6-7-8-24(28)29-23-12-11-21-20-10-9-18-17-19(27)13-15-25(18,2)22(20)14-16-26(21,23)3/h17,20-23H,4-16H2,1-3H3/t20-,21-,22-,23-,25-,26-/m0/s1 |
| grade | analytical standard |
Description
Testosterone Enanthate--Dea Schedule Iii