01904 488599
Tetrabutylammonium Bisulfate
From £328.02 per (ex VAT)
Tetrabutylammonium Bisulfate
| Product Code | 86853-10X1G-F |
|---|---|
| Unit of Measure | 10X1GR |
| CAS Number | 32503-27-8 |
| MDL NUMBER | MFCD00011637 |
| EMPIRICAL FORMULA | C16H37NO4S |
| Molecular Weight | 339.53 |
| Synonyms | Tetrabutylammonium Hydrogen Sulfate |
| Brand | SUPELCO |
Tiered Pricing - 86853-10X1G-F
| Qty | Discount | Price |
|---|---|---|
| 4+ | 13% | £370.62 |
| 12+ | 15% | £362.10 |
| 36+ | 17% | £353.58 |
| 72+ | 23% | £328.02 |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12000000 |
| ADRSuff | 1 |
| CAS Number | 32503-27-8 |
| EINECSNo | 251-068-5 |
| Flash Point | 175.6 C - closed cup |
| GHS Categories | Acute Tox. 4,Skin Irrit. 2,Eye Irrit. 2,STOT SE 3 |
| GHS Hazard Codes | H302-H315-H319-H335 |
| GHS Hazard Statements | Harmful if swallowed. Causes skin irritation. Causes serious eye irritation. May cause respiratory irritation. |
| GHS Pictograms | GHS07 |
| GHS Precaution Codes | P261 - P305 + P351 + P338 |
| GHS Signal Words | Warning |
| Hazard Symbols | Xn |
| Hazard Symbols Descriptions | Harmful |
| MDL Number | MFCD00011637 |
| Melting Point | 171-174 C |
| Molecular Formula | C16H37NO4S |
| Molecular Weight | 339.53 |
| Net Weight | 10 |
| R-Phrases | 22-36/37/38 |
| S-Phrases | 26-36 |
| Synonyms | Tetrabutylammonium hydrogen sulfate |
| Tariff Number | 29239000900 |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=86853brand=SIAL |
| Assay | >=99.0% (T) |
| UV absorption | lambda: 500 nm Amax: 0.02 |
| form | crystals |
| quality | LiChropur(TM) |
| lambda | 10 % in H2O |
| Anion Traces | bromide (Br-): <=50 mg/kg |
| suitability | corresponds to standard for RP gradient test |
| Quality Level | 100 |
| SMILES string | OS([O-])(=O)=O.CCCC[N+](CCCC)(CCCC)CCCC |
| InChI | 1S/C16H36N.H2O4S/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-5(2,3)4/h5-16H2,1-4H3;(H2,1,2,3,4)/q+1;/p-1 |
| mp | 171-174 C |
| technique(s) | HPLC: suitable |
| InChI key | SHFJWMWCIHQNCP-UHFFFAOYSA-M |
| description | cationic |
Description
Tetrabutylammonium Bisulfate