01904 488599
Tetrabutylammonium Hydroxide, For Ion
From £292.60 per (ex VAT)
Tetrabutylammonium Hydroxide, For Ion
| Product Code | 86854-500ML |
|---|---|
| Unit of Measure | 1X500ML |
| CAS Number | 2052-49-5 |
| MDL NUMBER | MFCD00009425 |
| EMPIRICAL FORMULA | C16H37NO |
| Molecular Weight | 259.47 |
| Brand | SUPELCO |
Tiered Pricing - 86854-500ML
| Qty | Discount | Price |
|---|---|---|
| 4+ | 13% | £330.60 |
| 12+ | 15% | £323.00 |
| 36+ | 17% | £315.40 |
| 72+ | 23% | £292.60 |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12000000 |
| ADRSuff | B |
| CAS Number | 2052-49-5 |
| ADR Hazard Labels | 8 |
| ADR Not Allowed by Post | X |
| ADR Number of Danger | 80 |
| ADR Packing Group | 2 |
| ADR Primary Hazard Class | 8 |
| ADR Proper Shipping Name | Corrosive liquid, basic, organic, n.o.s. |
| ADRNo | 3267 |
| Density | 0.995 g/cm3 |
| Flash Point | Not applicable |
| GHS Categories | Skin Corr. 1B |
| GHS Hazard Codes | H314 |
| GHS Hazard Statements | Causes severe skin burns and eye damage. |
| GHS Pictograms | GHS05 |
| GHS Precaution Codes | P280 - P305 + P351 + P338 - P310 |
| GHS Precaution Statements | Wear protective gloves/ protective clothing/ eye protection/ face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. Immediately call a POISON CENTER or doctor/ phys |
| GHS Signal Words | Danger |
| Hazard Symbols | C |
| Hazard Symbols Descriptions | Corrosive |
| MDL Number | MFCD00009425 |
| Molecular Formula | C16H37NO |
| Molecular Weight | 259.47 |
| Net Weight | 490 |
| R-Phrases | 34 |
| S-Phrases | 26-36/37/39-45 |
| Tariff Number | 29239000900 |
| Technical Name | TETRABUTYLAMMONIUM HYDROXIDE |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=86854brand=SIAL |
| cation traces | K: <=100 mg/kg |
| form | liquid |
| Anion Traces | sulfate (SO42-): <=100 mg/kg |
| technique(s) | ion chromatography: suitable |
| Quality Level | 100 |
| impurities | <=0.01% halides (as bromide) |
| SMILES string | [OH-].CCCC[N+](CCCC)(CCCC)CCCC |
| InChI | 1S/C16H36N.H2O/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;/h5-16H2,1-4H3;1H2/q+1;/p-1 |
| concentration | ~40% in water |
| description | cationic |
| InChI key | VDZOOKBUILJEDG-UHFFFAOYSA-M |
Description
Tetrabutylammonium Hydroxide, For Ion