01904 488599
Tetrahydrofuran-D8, >=99.5 Atom % D
From £360.80 per (ex VAT)
Tetrahydrofuran-D8, >=99.5 Atom % D
| Product Code | 184314-10G |
|---|---|
| Unit of Measure | 1X10GR |
| CAS Number | 1693-74-9 |
| MDL NUMBER | MFCD00044238 |
| EMPIRICAL FORMULA | C4H8O |
| Molecular Weight | 80.16 |
| Synonyms | Thf-D8; Deuterated Tetrahydrofuran; Octadeuterotetrahydrofuran |
| Brand | SIGMA-ALDRICH |
Tiered Pricing - 184314-10G
| Qty | Discount | Price |
|---|---|---|
| 4+ | 8% | £404.80 |
| 12+ | 10% | £396.00 |
| 36+ | 12% | £387.20 |
| 72+ | 18% | £360.80 |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12142201 |
| ADRSuff | 1 |
| CAS Number | 1693-74-9 |
| ADR Hazard Labels | 3 |
| ADR Number of Danger | 33 |
| ADR Packing Group | 2 |
| ADR Primary Hazard Class | 3 |
| ADR Proper Shipping Name | Tetrahydrofuran |
| ADRNo | 2056 |
| Boiling Point | 65-66 C (lit.) |
| Storage Temperature | 2-8C |
| Density | 0.985 g/mL at 25 C (lit.) |
| Dual Use Material | X |
| Flash Point | -17.5 C |
| GHS Categories | Flam. Liq. 2,Skin Irrit. 2,Eye Irrit. 2,Carc. 2 |
| GHS Hazard Codes | H225-H315-H319-H351 |
| GHS Hazard Statements | Highly flammable liquid and vapour. Causes skin irritation. Causes serious eye irritation. Suspected of causing cancer. |
| GHS Pictograms | GHS02,GHS08,GHS07 |
| GHS Precaution Codes | P210 - P281 - P305 + P351 + P338 |
| GHS Precaution Statements | Keep away from heat/sparks/open flames/hot surfaces. - No smoking. Avoid breathing dust/ fume/ gas/ mist/ vapours/ spray. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. |
| GHS Signal Words | Danger |
| Hazard Symbols | F,Xi |
| Hazard Symbols Descriptions | Highly flammable, Irritant |
| MDL Number | MFCD00044238 |
| Melting Point | -106 C (lit.) |
| Molecular Formula | C4H8O |
| Molecular Weight | 80.16 |
| Net Weight | 10 |
| R-Phrases | 11-19-36/37 |
| S-Phrases | 16-29-33 |
| Synonyms | THF-d8; Deuterated tetrahydrofuran; Octadeuterotetrahydrofuran |
| Tariff Number | 28459010000 |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=184314brand=ALDRICH |
| InChI key | WYURNTSHIVDZCO-SVYQBANQSA-N |
| Assay | >=99% (CP) |
| bp | 65-66 C (lit.) |
| Quality Level | 200 |
| mp | -106 C (lit.) |
| InChI | 1S/C4H8O/c1-2-4-5-3-1/h1-4H2/i1D2,2D2,3D2,4D2 |
| form | liquid |
| refractive index | n20/D 1.403 (lit.) |
| storage temp. | 2-8C |
| technique(s) | NMR: suitable |
| impurities | <=0.03% waterwater |
| isotopic purity | >=99.5 atom % D |
| SMILES string | [2H]C1([2H])OC([2H])([2H])C([2H])([2H])C1([2H])[2H] |
| mass shift | M+8 |
Description
Tetrahydrofuran-D8, >=99.5 Atom % D