01904 488599
Zincon Sodium Salt, Dye Content >=75%
From £153.36 per (ex VAT)
Zincon Sodium Salt, Dye Content >=75%
| Product Code | 201332-5G |
|---|---|
| Unit of Measure | 1X5GR |
| CAS Number | 56484-13-0 |
| Synonyms | 2-Carboxy-2'-Hydroxy-5'-Sulfoformazyl-Benzene Sodium Salt; 2-[5-(2-Hydroxy-5-Sulfophenyl)-3-Phenyl-1-Formazyl]Benzoic Acid Sodium Salt |
| Brand | SIGMA-ALDRICH |
Tiered Pricing - 201332-5G
| Qty | Discount | Price |
|---|---|---|
| 4+ | 18% | £174.66 |
| 12+ | 20% | £170.40 |
| 36+ | 22% | £166.14 |
| 72+ | 28% | £153.36 |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12171500 |
| ADRSuff | 1 |
| CAS Number | 56484-13-0 |
| Storage Temperature | room temp |
| Flash Point | Not applicable |
| GHS Categories | Skin Irrit. 2,Eye Irrit. 2 |
| GHS Hazard Codes | H315-H319 |
| GHS Hazard Statements | Causes skin irritation. Causes serious eye irritation. |
| GHS Pictograms | GHS07 |
| GHS Precaution Codes | P305 + P351 + P338 |
| GHS Precaution Statements | IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. |
| GHS Signal Words | Warning |
| Hazard Symbols | Xi |
| Hazard Symbols Descriptions | Irritant |
| Melting Point | 250 C |
| Net Weight | 5 |
| R-Phrases | 36/38 |
| S-Phrases | 26-36 |
| Synonyms | 2-Carboxy-2'-hydroxy-5'-sulfoformazyl-benzene sodium salt; 2-[5-(2-Hydroxy-5-sulfophenyl)-3-phenyl-1-formazyl]benzoic acid sodium salt |
| Tariff Number | 32129000000 |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=201332brand=ALDRICH |
| SMILES string | [Na+].OC(=O)c1ccccc1N=NC(=NNc2cc(ccc2O)S([O-])(=O)=O)c3ccccc3 |
| Composition | Dye content, >=75% |
| storage temp. | room temp |
| Application(s) | diagnostic assay manufacturinghematologyhistology |
| lambdamax | 523 nm |
| Quality Level | 100 |
| epsilon (extinction coefficient) | >=10000 at 489-495 nm in methanol |
| form | powder |
| mp | 250 C |
| solubility | 0.1 M NaOH: 1 mg/mL |
Description
Zincon Sodium Salt, Dye Content >=75%