01904 488599
O-Tolidine, >=95%
From £248.00 per (ex VAT)
O-Tolidine, >=95%
| Product Code | T8533-100G |
|---|---|
| Unit of Measure | 1X100GR |
| CAS Number | 119-93-7 |
| MDL NUMBER | MFCD00014773 |
| EMPIRICAL FORMULA | C14H16N2 |
| Molecular Weight | 212.29 |
| Synonyms | 3,3'-Dimethylbenzidine; 4,4'-Bianisidine |
| Brand | SIGMA-ALDRICH |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12171500 |
| ADRSuff | 1 |
| CAS Number | 119-93-7 |
| ADR Number of Danger | 90 |
| Storage Temperature | room temp |
| EINECSNo | 204-358-0 |
| Flash Point | 100 C - closed cup |
| GHS Categories | Acute Tox. 4,Carc. 1B,Aquatic Chronic 2 |
| GHS Hazard Codes | H302-H350-H411 |
| GHS Hazard Statements | Harmful if swallowed. May cause cancer. Toxic to aquatic life with long lasting effects. |
| GHS Pictograms | GHS08,GHS07,GHS09 |
| GHS Precaution Codes | P201 - P273 - P308 + P313 |
| GHS Precaution Statements | Obtain special instructions before use. Avoid release to the environment. IF exposed or concerned: Get medical advice/ attention. |
| GHS Signal Words | Danger |
| Hazard Symbols | T,N |
| Hazard Symbols Descriptions | Toxic, Dangerous for the environment |
| MDL Number | MFCD00014773 |
| Melting Point | 128-131 C (lit.) |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.29 |
| Net Weight | 100 |
| R-Phrases | 45-22-51/53 |
| RTECSNo | DD1225000 |
| S-Phrases | 53-45-61 |
| Synonyms | 3,3'-Dimethylbenzidine; 4,4'-Bianisidine |
| Tariff Number | 29215950900 |
| Technical Name | O-TOLIDINE |
| SMILES string | Cc1cc(ccc1N)-c2ccc(N)c(C)c2 |
| Quality Level | 200 |
| InChI | 1S/C14H16N2/c1-9-7-11(3-5-13(9)15)12-4-6-14(16)10(2)8-12/h3-8H,15-16H2,1-2H3 |
| Assay | >=95% |
| InChI key | NUIURNJTPRWVAP-UHFFFAOYSA-N |
| storage temp. | room temp |
| Application(s) | diagnostic assay manufacturinghematologyhistology |
| form | powder or chunks |
| mp | 128-131 C (lit.) |
Description
O-Tolidine, >=95%