01904 488599
L-Tartaric Acid, 99.5%, A.C.S. Reagent (
From £61.17 per (ex VAT)
L-Tartaric Acid, 99.5%, A.C.S. Reagent (
| Product Code | 251380-500G |
|---|---|
| Unit of Measure | 1X500GR |
| CAS Number | 87-69-4 |
| MDL NUMBER | MFCD00064207 |
| EMPIRICAL FORMULA | C4H6O6 |
| Molecular Weight | 150.09 |
| Synonyms | (2R,3R)-(+)-Tartaric Acid; L-Threaric Acid |
| Brand | SIGMA-ALDRICH |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12352100 |
| ADRSuff | 1 |
| CAS Number | 87-69-4 |
| EINECSNo | 201-766-0 |
| Flash Point | 150 C - closed cup |
| GHS Categories | Eye Dam. 1 |
| GHS Hazard Codes | H318 |
| GHS Hazard Statements | Causes serious eye damage. |
| GHS Pictograms | GHS05 |
| GHS Precaution Codes | P280 - P305 + P351 + P338 |
| GHS Precaution Statements | Avoid breathing dust/ fume/ gas/ mist/ vapours/ spray. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. |
| GHS Signal Words | Danger |
| Hazard Symbols | Xi |
| Hazard Symbols Descriptions | Irritant |
| MDL Number | MFCD00064207 |
| Melting Point | 170-172 C (lit.) |
| Molecular Formula | C4H6O6 |
| Molecular Weight | 150.09 |
| Net Weight | 500 |
| R-Phrases | 41 |
| RTECSNo | WW7875000 |
| S-Phrases | 26-36/37/39 |
| Synonyms | (2R,3R)-(+)-Tartaric acid; L-Threaric acid |
| Tariff Number | 29181200900 |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=251380brand=SIAL |
| vapor density | 5.18 (vs air) |
| InChI | 1S/C4H6O6/c5-1(3(7)8)2(6)4(9)10/h1-2,5-6H,(H,7,8)(H,9,10)/t1-,2-/m1/s1 |
| Quality Level | 200 |
| Assay | >=99.5% |
| form | crystals |
| impurities | <=0.002% S compounds |
| Anion Traces | oxalate (C2O42-): passes test |
| autoignition temp. | 797 F |
| optical activity | [alpha]20/D +12.4, c = 20 in H2O |
| grade | ACS reagent |
| cation traces | Fe: <=5 ppm |
| mp | 170-172 C (lit.) |
| SMILES string | O[C@H]([C@@H](O)C(O)=O)C(O)=O |
| InChI key | FEWJPZIEWOKRBE-JCYAYHJZSA-N |
| ign. residue | <=0.02% |
| optical purity | ee: 99% (GLC) |
Description
L-Tartaric Acid, 99.5%, A.C.S. Reagent (