2-(4-Hydroxyphenylazo)Benzoic Acid,>= 9
From £13.61 per (ex VAT)
2-(4-Hydroxyphenylazo)Benzoic Acid,>= 9
| Product Code | H5126-1G |
|---|---|
| Unit of Measure | 1X1GR |
| CAS Number | 1634-82-8 |
| MDL NUMBER | MFCD00002428 |
| EMPIRICAL FORMULA | C13HN2O3 |
| Molecular Weight | 242.23 |
| Synonyms | 2-(4'-Hydroxybenzeneazo)Benzoic Acid; 4'-Hydroxyazobenzene-2-Carboxylic Acid; Haba; Hbaba |
| Brand | SIGMA-ALDRICH |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12352100 |
| ADRSuff | 1 |
| CAS Number | 1634-82-8 |
| EINECSNo | 216-655-2 |
| Flash Point | Not applicable |
| GHS Categories | Skin Irrit. 2,Eye Irrit. 2,STOT SE 3 |
| GHS Hazard Codes | H315-H319-H335 |
| GHS Hazard Statements | Causes skin irritation. Causes serious eye irritation. May cause respiratory irritation. |
| GHS Pictograms | GHS07 |
| GHS Precaution Codes | P261 - P305 + P351 + P338 |
| GHS Signal Words | Warning |
| Hazard Symbols | Xi |
| Hazard Symbols Descriptions | Irritant |
| MDL Number | MFCD00002428 |
| Melting Point | 204-208 C (lit.) |
| Molecular Formula | C13HN2O3 |
| Molecular Weight | 242.23 |
| GHS Precaution Statements | Avoid breathing dust/ fume/ gas/ mist/ vapours/ spray. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. |
| Net Weight | 1 |
| R-Phrases | 36/37/38 |
| S-Phrases | 26-36 |
| Synonyms | 2-(4'-Hydroxybenzeneazo)benzoic acid; 4'-Hydroxyazobenzene-2-carboxylic acid; HABA; HBABA |
| Tariff Number | 29270000900 |
| solubility | ethanol: 20 mg/mL, clear to hazy, orange to very deep orange |
| Quality Level | 200 |
| Assay | >=95% (HPLC) |
| mp | 204-208 C (lit.) |
| InChI key | DWQOTEPNRWVUDA-CCEZHUSRSA-N |
| InChI | 1S/C13H10N2O3/c16-10-7-5-9(6-8-10)14-15-12-4-2-1-3-11(12)13(17)18/h1-8,16H,(H,17,18)/b15-14+ |
| SMILES string | Oc1ccc(cc1)N=Nc2ccccc2C(O)=O |
Description
2-(4-Hydroxyphenylazo)Benzoic Acid,>= 9