Xphos Pd G1
From £62.20 per (ex VAT)
Xphos Pd G1
| Product Code | 704954-250MG |
|---|---|
| Unit of Measure | 1X250MG |
| CAS Number | 1028206-56-5 |
| MDL NUMBER | MFCD13194128 |
| EMPIRICAL FORMULA | C41H59ClNPPd |
| Molecular Weight | 738.76 |
| Synonyms | (2-Dicyclohexylphosphino-2',4',6'-Triisopropyl-1,1'-Biphenyl)[2-(2-Aminoethyl)Phenyl)]Palladium(Ii) Chloride; (Xphos) Palladium(Ii) Phenethylamine Chloride; Chloro(2-Dicyclohexylphosphino-2',4',6'-Triisopropyl-1,1'-Biphenyl)[2-(2-Aminoethyl)Phenyl)]Pallad |
| Brand | SIGMA-ALDRICH |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12352300 |
| ADRSuff | 1 |
| CAS Number | 1028206-56-5 |
| GHS Categories | Skin Irrit. 2,Eye Irrit. 2,STOT SE 3,Aquatic Chronic 3 |
| GHS Hazard Codes | H315-H319-H335-H412 |
| GHS Hazard Statements | Causes skin irritation. Causes serious eye irritation. May cause respiratory irritation. Harmful to aquatic life with long lasting effects. |
| GHS Pictograms | GHS07 |
| GHS Precaution Codes | P261 - P273 - P305 + P351 + P338 |
| GHS Precaution Statements | Avoid breathing dust/ fume/ gas/ mist/ vapours/ spray. Avoid release to the environment. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. |
| GHS Signal Words | Warning |
| Hazard Symbols | Xi |
| Hazard Symbols Descriptions | Irritant |
| MDL Number | MFCD13194128 |
| Melting Point | 205-210 C |
| Molecular Formula | C41H59ClNPPd |
| Molecular Weight | 738.76 |
| Net Weight | 250 |
| R-Phrases | 36/37/38-52/53 |
| S-Phrases | 26-61 |
| Synonyms | (2-Dicyclohexylphosphino-2',4',6'-triisopropyl-1,1'-biphenyl)[2-(2-aminoethyl)phenyl)]palladium(II) chloride; (XPhos) palladium(II) phenethylamine chloride; Chloro(2-dicyclohexylphosphino-2',4',6'-triisopropyl-1,1'-biphenyl)[2-(2-aminoethyl)phenyl)]pallad |
| Tariff Number | 28439090000 |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=704954brand=ALDRICH |
| reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction |
| feature | generation 1 |
| InChI | 1S/C33H49P.C8H10N.ClH.Pd/c1-23(2)26-21-30(24(3)4)33(31(22-26)25(5)6)29-19-13-14-20-32(29)34(27-15-9-7-10-16-27)28-17-11-8-12-18-28;9-7-6-8-4-2-1-3-5-8;;/h13-14,19-25,27-28H,7-12,15-18H2,1-6H3;1-4H,6-7,9H2;1H;/q;;;+1/p-1 |
| Quality Level | 100 |
| SMILES string | NCCc1ccccc1[Pd]Cl.CC(C)c2cc(C(C)C)c(c(c2)C(C)C)-c3ccccc3P(C4CCCCC4)C5CCCCC5 |
| functional group | phosphine |
| form | solid |
| mp | 205-210 C |
| InChI key | HTAJCNQBAFZEJO-UHFFFAOYSA-M |
Description
Xphos Pd G1