01904 488599
Hygromycin B From Streptomyces Hygroscop
From £143.22 per (ex VAT)
Hygromycin B From Streptomyces Hygroscop
| Product Code | H7772-1G |
|---|---|
| Unit of Measure | 1X1GR |
| CAS Number | 31282-04-9 |
| MDL NUMBER | MFCD06795479 |
| EMPIRICAL FORMULA | C2H37N3O13 |
| Molecular Weight | 527.52 |
| Brand | SIGMA-ALDRICH |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12350000 |
| ADRSuff | A |
| CAS Number | 31282-04-9 |
| ADR Hazard Labels | 6.1 |
| ADR Number of Danger | 66 |
| ADR Packing Group | 1 |
| ADR Primary Hazard Class | 6.1 |
| ADR Proper Shipping Name | Toxins, extracted from living sources, solid, n.o.s. |
| ADRNo | 3462 |
| Storage Temperature | 2-8C |
| EINECSNo | 250-545-5 |
| Flash Point | Not applicable |
| GHS Categories | Acute Tox. 2,Acute Tox. 2,Eye Dam. 1,Acute Tox. 1,Resp. Sens. 1 |
| GHS Hazard Codes | H300-H310-H318-H330-H334 |
| GHS Hazard Statements | Fatal if swallowed. Fatal in contact with skin. Causes serious eye damage. Fatal if inhaled. May cause allergy or asthma symptoms or breathing difficulties if inhaled. |
| GHS Pictograms | GHS06,GHS08,GHS05 |
| GHS Precaution Codes | P260 - P264 - P280 - P284 - P301 + P310 - P302 + P350 |
| GHS Precaution Statements | Do not breathe dust/ fume/ gas/ mist/ vapours/ spray. Wash hands thoroughly after handling. Wear protective gloves/ eye protection/ face protection. Wear respiratory protection. IF SWALLOWED: Immediately call a POISON CENTER or doctor/ physician. IF ON SK |
| GHS Signal Words | Danger |
| Hazard Symbols | T+ |
| Hazard Symbols Descriptions | Very toxic |
| MDL Number | MFCD06795479 |
| Molecular Formula | C2H37N3O13 |
| Molecular Weight | 527.52 |
| Net Weight | 1 |
| R-Phrases | 26/27/28-41-42/43 |
| RTECSNo | WK2130000 |
| S-Phrases | 22-26-28-36/37/39-45 |
| Tariff Number | 29419000000 |
| Technical Name | HYGROMYCIN B |
| biological source | Streptomyces hygroscopicus |
| Quality Level | 200 |
| storage temp. | 2-8C |
| purified by | ion-exchange chromatography |
| Mode of action | protein synthesis | interferes |
| InChI key | GRRNUXAQVGOGFE-XKIAHZFYSA-N |
| color | white to beige |
| form | lyophilized powder |
| InChI | 1S/C20H37N3O13/c1-23-7-2-5(21)9(26)15(10(7)27)33-19-17-16(11(28)8(4-25)32-19)35-20(36-17)18(31)13(30)12(29)14(34-20)6(22)3-24/h5-19,23-31H,2-4,21-22H2,1H3/t5-,6-,7+,8-,9+,10-,11+,12-,13+,14-,15-,16+,17+,18-,19+,20+/m1/s1 |
| solubility | H2O: 50 mg/mL |
| Antibiotic Activity Spectrum | viruses |
| SMILES string | CN[C@H]1C[C@@H](N)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO)[C@H](O)[C@@H]3O[C@]4(O[C@H]([C@H](N)CO)[C@H](O)[C@H](O)[C@H]4O)O[C@H]23)[C@@H]1O |
Description
Hygromycin B From Streptomyces Hygroscop