2-Mercaptopyridine N-Oxide Sodium Salt
From £790.00 per (ex VAT)
2-Mercaptopyridine N-Oxide Sodium Salt
| Product Code | H3261-100G |
|---|---|
| Unit of Measure | 1X100GR |
| CAS Number | 3811-73-2 |
| MDL NUMBER | MFCD01941547 |
| EMPIRICAL FORMULA | C5H4NNaOS |
| Molecular Weight | 149.15 |
| Synonyms | 1-Hydroxy-2-Pyridinethione Sodium Salt; 2-Mercaptopyridine-1-Oxide Sodium Salt; 2-Pyridinethiol-1-Oxide Sodium Salt; Pyrithione Sodium Salt |
| Brand | SIGMA-ALDRICH |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12350000 |
| ADRSuff | 1 |
| CAS Number | 3811-73-2 |
| EINECSNo | 223-296-5 |
| Flash Point | Not applicable |
| GHS Categories | Acute Tox. 4,Skin Irrit. 2,Eye Irrit. 2,STOT SE 3 |
| GHS Hazard Codes | H302-H315-H319-H335 |
| GHS Hazard Statements | Harmful if swallowed. Causes skin irritation. Causes serious eye irritation. May cause respiratory irritation. |
| GHS Pictograms | GHS07 |
| GHS Precaution Codes | P261 - P305 + P351 + P338 |
| GHS Precaution Statements | Avoid breathing dust/ fume/ gas/ mist/ vapours/ spray. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. |
| GHS Signal Words | Warning |
| Hazard Symbols | Xn |
| Hazard Symbols Descriptions | Harmful |
| MDL Number | MFCD01941547 |
| Molecular Formula | C5H4NNaOS |
| Molecular Weight | 149.15 |
| Net Weight | 100 |
| R-Phrases | 22-36/37/38 |
| RTECSNo | UT9000000 |
| S-Phrases | 26-36 |
| Synonyms | 1-Hydroxy-2-pyridinethione sodium salt; 2-Mercaptopyridine-1-oxide sodium salt; 2-Pyridinethiol-1-oxide sodium salt; Pyrithione sodium salt |
| Tariff Number | 29333999900 |
| Antibiotic Activity Spectrum | fungi |
| Quality Level | 200 |
| Assay | >=96% |
| biological source | synthetic |
| Mode of action | cell membrane | interferes |
| InChI | 1S/C5H5NOS.Na/c7-6-4-2-1-3-5(6)8;/h1-4,8H;/q;+1/p-1 |
| color | white to light yellow |
| InChI key | WNGMMIYXPIAYOB-UHFFFAOYSA-M |
| SMILES string | [Na+].[O-][n+]1ccccc1[S-] |
| solubility | H2O: 50 mg/mL |
Description
2-Mercaptopyridine N-Oxide Sodium Salt