01904 488599
G 418 Disulfate Salt Solution Sterile-F
From £596.64 per (ex VAT)
G 418 Disulfate Salt Solution Sterile-F
| Product Code | G8168-100ML |
|---|---|
| Unit of Measure | 1X100ML |
| CAS Number | 108321-42-2 |
| MDL NUMBER | MFCD00058314 |
| EMPIRICAL FORMULA | C2H4N4O |
| Molecular Weight | 692.71 |
| Synonyms | Antibiotic G418 |
| Brand | SIGMA-ALDRICH |
Tiered Pricing - G8168-100ML
| Qty | Discount | Price |
|---|---|---|
| 4+ | 8% | £623.76 |
| 12+ | 10% | £610.20 |
| 36+ | 12% | £596.64 |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12350000 |
| ADRSuff | 1 |
| CAS Number | 108321-42-2 |
| Storage Temperature | 2-8C |
| Flash Point | Not applicable |
| GHS Categories | Skin Sens. 1 |
| GHS Hazard Codes | H317 |
| GHS Hazard Statements | May cause an allergic skin reaction. |
| GHS Pictograms | GHS07 |
| GHS Precaution Codes | P280 |
| GHS Signal Words | Warning |
| Hazard Symbols | Xn |
| Hazard Symbols Descriptions | Harmful |
| MDL Number | MFCD00058314 |
| Molecular Formula | C2H4N4O |
| Molecular Weight | 692.71 |
| Net Weight | 1 |
| R-Phrases | 42/43 |
| S-Phrases | 23-36/37-45 |
| Synonyms | Antibiotic G418 |
| Tariff Number | 29419000000 |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=G8168brand=SIGMA |
| impurities | endotoxin, tested |
| Quality Level | 200 |
| mol wt | 692.7 |
| product line | BioReagent |
| biological source | Micromonospora echinospora |
| Mode of action | protein synthesis | interferes |
| potency | 50-60 mg per mL |
| sterility | 0.1 mum filtered |
| InChI | 1S/C20H40N4O10.2H2O4S/c1-6(25)14-11(27)10(26)9(23)18(32-14)33-15-7(21)4-8(22)16(12(15)28)34-19-13(29)17(24-3)20(2,30)5-31-19;2*1-5(2,3)4/h6-19,24-30H,4-5,21-23H2,1-3H3;2*(H2,1,2,3,4)/t6?,7-,8+,9+,10+,11-,12-,13-,14+,15+,16-,17-,18+,19-,20+;;/m0../s1 |
| solubility | H2O: 50 mg/mL, clear |
| technique(s) | cell culture | mammalian: suitable |
| color | colorless |
| form | solution |
| InChI key | UHEPSJJJMTWUCP-NKCAIAFTSA-N |
| storage temp. | 2-8C |
| Antibiotic Activity Spectrum | parasites |
| packaging | pkg of 10 and 100 mL |
| SMILES string | OS(O)(=O)=O.OS(O)(=O)=O.CN[C@H]1[C@H](O)[C@@H](OC[C@@]1(C)O)O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H]([C@H](C)O)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O |
| concentration | 50 mg/mL in H2O |
Description
G 418 Disulfate Salt Solution Sterile-F