01904 488599
Calcium Ionophore A23187
From £283.00 per (ex VAT)
Calcium Ionophore A23187
| Product Code | C7522-10MG |
|---|---|
| Unit of Measure | 1X10MG |
| CAS Number | 52665-69-7 |
| MDL NUMBER | MFCD00151202 |
| EMPIRICAL FORMULA | C29H37N3O6 |
| Molecular Weight | 523.62 |
| Synonyms | Antibiotic A 23187; Calimycin |
| Brand | SIGMA-ALDRICH |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12352200 |
| ADRSuff | 1 |
| CAS Number | 52665-69-7 |
| Storage Temperature | 2-8C |
| EINECSNo | 258-084-1 |
| Flash Point | Not applicable |
| GHS Categories | NH |
| GHS Hazard Codes | NH |
| GHS Hazard Statements | NH |
| GHS Pictograms | - |
| GHS Precaution Codes | - |
| GHS Signal Words | - |
| Hazard Symbols | Xi |
| Hazard Symbols Descriptions | Irritant |
| GHS Precaution Statements | Avoid breathing dust/ fume/ gas/ mist/ vapours/ spray. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. |
| MDL Number | MFCD00151202 |
| Molecular Formula | C29H37N3O6 |
| Molecular Weight | 523.62 |
| Net Weight | 10 |
| R-Phrases | 36/37/38 |
| RTECSNo | DM4676000 |
| S-Phrases | 26-36 |
| Synonyms | Antibiotic A 23187; Calimycin |
| Tariff Number | 29419000000 |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=C7522brand=SIGMA |
| Antibiotic Activity Spectrum | fungi |
| Quality Level | 300 |
| storage temp. | 2-8C |
| solubility | ethanol: 5 mg/mL (with heating. Solutions are stable for at least 3 months at -20Â C when protected from light and water contamination.) |
| InChI key | HIYAVKIYRIFSCZ-CYEMHPAKSA-N |
| Mode of action | cell membrane | interferes |
| sterility | non-sterile |
| color | white to light yellow |
| form | powder |
| InChI | 1S/C29H37N3O6/c1-15-10-11-29(17(3)13-16(2)27(38-29)18(4)26(33)20-7-6-12-31-20)37-22(15)14-23-32-25-21(36-23)9-8-19(30-5)24(25)28(34)35/h6-9,12,15-18,22,27,30-31H,10-11,13-14H2,1-5H3,(H,34,35)/t15-,16-,17-,18-,22-,27+,29+/m1/s1 |
| SMILES string | [H][C@@]1(O[C@@]2(CC[C@@H](C)[C@@H](Cc3nc4c(C(O)=O)c(NC)ccc4o3)O2)[C@H](C)C[C@H]1C)[C@H](C)C(=O)c5ccc[nH]5 |
| Assay | >=98% (TLC) |
Description
Calcium Ionophore A23187