Crystal Violet Acs Reagent
From £47.90 per (ex VAT)
Crystal Violet Acs Reagent
| Product Code | C6158-50G |
|---|---|
| Unit of Measure | 1X50GR |
| CAS Number | 548-62-9 |
| MDL NUMBER | MFCD00011750 |
| EMPIRICAL FORMULA | C25H3ClN3 |
| Molecular Weight | 407.98 |
| Synonyms | Basic Violet 3; Gentian Violet; Hexamethylpararosaniline Chloride; Methyl Violet 10B |
| Brand | SIGMA-ALDRICH |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12171500 |
| ADRSuff | 1 |
| CAS Number | 548-62-9 |
| ADR Number of Danger | 90 |
| Storage Temperature | room temp |
| Density | 1.19 g/cm3 at 20 C |
| EINECSNo | 208-953-6 |
| Flash Point | Not applicable |
| GHS Precaution Statements | Avoid release to the environment. Wear protective gloves/ eye protection/ face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. Dispose of contents/ container to a |
| Hazard Symbols | Xn,N |
| Hazard Symbols Descriptions | Harmful, Dangerous for the environment |
| MDL Number | MFCD00011750 |
| Melting Point | 205 C (dec.) (lit.) |
| Molecular Formula | C25H3ClN3 |
| Molecular Weight | 407.98 |
| Net Weight | 50 |
| R-Phrases | 22-40-41-50/53 |
| S-Phrases | 26-36/37/39-46-60-61 |
| Synonyms | Basic Violet 3; Gentian Violet; Hexamethylpararosaniline chloride; Methyl Violet 10B |
| Tariff Number | 32129000000 |
| Technical Name | CRYSTAL VIOLET |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=C6158brand=SIGMA |
| Antibiotic Activity Spectrum | fungi |
| Quality Level | 200 |
| grade | ACS reagent |
| Mode of action | cell membrane | interferes |
| storage temp. | room temp |
| Assay | >=90.0% anhydrous basis |
| loss | <=7.5% loss on drying |
| suitability | passes test for sensitivity as indicator |
| form | powder |
| Application(s) | diagnostic assay manufacturinghematologyhistology |
| solubility | water: soluble 50 g/L at 27 C |
| Absorption | passes test |
| SMILES string | [Cl-].CN(C)c1ccc(cc1)C(c2ccc(cc2)N(C)C)=C3/C=CC(C=C3)=[N+](/C)C |
| InChI key | ZXJXZNDDNMQXFV-UHFFFAOYSA-M |
| mp | 205 C (dec.) (lit.) |
| InChI | 1S/C25H30N3.ClH/c1-26(2)22-13-7-19(8-14-22)25(20-9-15-23(16-10-20)27(3)4)21-11-17-24(18-12-21)28(5)6;/h7-18H,1-6H3;1H/q+1;/p-1 |
Description
Crystal Violet Acs Reagent