01904 488599
Citric Acid, 99.5+%, A.C.S. Reagent
From £33.54 per (ex VAT)
Citric Acid, 99.5+%, A.C.S. Reagent
| Product Code | 251275-5G |
|---|---|
| Unit of Measure | 1X5GR |
| CAS Number | 77-92-9 |
| MDL NUMBER | MFCD00011669 |
| EMPIRICAL FORMULA | C6H8O7 |
| Molecular Weight | 192.12 |
| Brand | SIGMA-ALDRICH |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32030000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12352100 |
| ADRSuff | 1 |
| CAS Number | 77-92-9 |
| EINECSNo | 201-069-1 |
| Flash Point | Not applicable |
| GHS Categories | Eye Irrit. 2 |
| GHS Hazard Codes | H319 |
| GHS Hazard Statements | Causes serious eye irritation. |
| GHS Pictograms | GHS07 |
| GHS Precaution Codes | P280 - P305 + P351 + P338 - P337 + P313 |
| GHS Precaution Statements | Wear protective gloves/ eye protection/ face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. |
| GHS Signal Words | Warning |
| Hazard Symbols | Xi |
| Hazard Symbols Descriptions | Irritant |
| MDL Number | MFCD00011669 |
| Melting Point | 153-159 C (lit.) |
| Molecular Formula | C6H8O7 |
| Molecular Weight | 192.12 |
| Net Weight | 5 |
| R-Phrases | 36 |
| RTECSNo | GE7350000 |
| S-Phrases | 26 |
| Tariff Number | 29181400900 |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=251275brand=SIAL |
| Quality Level | 200 |
| Assay | >=99.5% |
| InChI | 1S/C6H8O7/c7-3(8)1-6(13,5(11)12)2-4(9)10/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| pKa | (1) 3.13, (2) 4.76, (3) 6.4 |
| form | crystals |
| SMILES string | OC(=O)CC(O)(CC(O)=O)C(O)=O |
| cation traces | Pb: <=2 ppm |
| impurities | Substances carbonizable by hot sulfuric acid, passes test |
| Anion Traces | oxalate (C2O42-): passes test (limit about 0.003%) |
| grade | ACS reagent |
| expl. lim. | 8 %, 65 F |
| Gene Information | human ... SRC(6714) |
| mp | 153-159 C (lit.) |
| ign. residue | <=0.02% |
| InChI key | KRKNYBCHXYNGOX-UHFFFAOYSA-N |
Description
Citric Acid, 99.5+%, A.C.S. Reagent