01904 488599
Gram’S Fuchsin Solution*
From £39.90 per (ex VAT)
Gram’S Fuchsin Solution*
| Product Code | 87794-250ML-F |
|---|---|
| Unit of Measure | 1X250ML |
| CAS Number | 632-99-5 |
| MDL NUMBER | MFCD18071399 |
| Synonyms | Fuchsin Solution |
| Brand | SIGMA-ALDRICH |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12171500 |
| ADRSuff | 1 |
| CAS Number | 632-99-5 |
| ADR Number of Danger | 33 |
| Storage Temperature | room temp |
| Density | 0.999 g/mL at 20 C |
| Flash Point | Not applicable |
| GHS Categories | NH |
| GHS Hazard Codes | NH |
| GHS Hazard Statements | NH |
| GHS Pictograms | - |
| GHS Precaution Codes | - |
| GHS Precaution Statements | Keep away from heat/sparks/open flames/hot surfaces. - No smoking. |
| GHS Signal Words | - |
| MDL Number | MFCD18071399 |
| Net Weight | 249.5 |
| Synonyms | Fuchsin solution |
| Tariff Number | 32129000000 |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=87794brand=SIAL |
| product line | BioChemika |
| refractive index | n20/D 1.334 |
| shelf life | limited shelf life, expiry date on the label |
| storage temp. | room temp |
| InChI | 1S/C9H17NO2.BrH/c1-7(11)6-8-9(12-2)4-3-5-10-8;/h8-10H,3-6H2,1-2H3;1H/t8-,9+;/m0./s1 |
| form | liquid |
| Application(s) | diagnostic assay manufacturinghematologyhistology |
| technique(s) | microbe id | staining: suitable |
| Quality Level | 100 |
| SMILES string | Br.CO[C@@H]1CCCN[C@H]1CC(C)=O |
| grade | for microscopy |
| Antibiotic Activity Spectrum | Gram-positive bacteria |
| lambdamax | 545-555 nm in 50% ethanol |
| InChI key | DVSQBUUDEVNABC-OULXEKPRSA-N |
Description
Gram'S Fuchsin Solution*