01904 488599
Acetylacetone, Reagentplus, >=99%
From £19.11 per (ex VAT)
Acetylacetone, Reagentplus, >=99%
| Product Code | P7754-250ML-A |
|---|---|
| Unit of Measure | 1X250ML |
| CAS Number | 123-54-6 |
| MDL NUMBER | MFCD00008787 |
| EMPIRICAL FORMULA | C5H8O2 |
| Molecular Weight | 100.12 |
| Synonyms | 2,4-Pentanedione |
| Brand | SIGMA-ALDRICH |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32030000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12352100 |
| ADRSuff | 1 |
| CAS Number | 123-54-6 |
| ADR Hazard Labels | 3 |
| ADR Number of Danger | 36 |
| ADR Packing Group | 3 |
| ADR Primary Hazard Class | 3 |
| ADR Proper Shipping Name | Pentane-2,4-dione |
| ADR SubHaz Classes | 6.1 |
| ADRNo | 2310 |
| Boiling Point | 140.4 C (lit.) |
| Density | 0.975 g/mL at 25 C (lit.) |
| EINECSNo | 204-634-0 |
| Flash Point | 35 C - Non-equilibrium method |
| GHS Categories | Flam. Liq. 3,Acute Tox. 4,Acute Tox. 3,Acute Tox. 3 |
| GHS Hazard Codes | H226-H302-H311-H331 |
| GHS Hazard Statements | Flammable liquid and vapour. Harmful if swallowed. Toxic in contact with skin. Toxic if inhaled. |
| GHS Pictograms | GHS02,GHS06 |
| GHS Precaution Codes | P210 - P261 - P280 - P302 + P352 + P312 - P304 + P340 + P311 - P370 + P378 |
| GHS Signal Words | Danger |
| Hazard Symbols | Xn |
| Hazard Symbols Descriptions | Harmful |
| MDL Number | MFCD00008787 |
| Melting Point | -23 C (lit.) |
| Molecular Formula | C5H8O2 |
| Molecular Weight | 100.12 |
| Net Weight | 243 |
| R-Phrases | 10-20/21/22 |
| RTECSNo | SA1925000 |
| S-Phrases | 21-23-24/25 |
| Synonyms | 2,4-Pentanedione |
| Tariff Number | 29141990900 |
| Quality Level | 200 |
| InChI key | XMRPGKVKISIQBV-BJMCWZGWSA-N |
| form | powder |
| SMILES string | [H][C@@]12CC[C@@]3([H])[C@]4([H])CC[C@H](C(C)=O)[C@@]4(C)CC[C@]3([H])[C@@]1(C)CCC(=O)C2 |
| InChI | 1S/C21H32O2/c1-13(22)17-6-7-18-16-5-4-14-12-15(23)8-10-20(14,2)19(16)9-11-21(17,18)3/h14,16-19H,4-12H2,1-3H3/t14-,16-,17+,18-,19-,20-,21+/m0/s1 |
| Gene Information | human ... ACHE(43), BCHE(590), CES1(1066) |
| pH | 6 (20 C, 200 g/L) |
| expl. lim. | 11.4 % |
| product line | ReagentPlus(R) |
| mp | -23 C (lit.) |
| autoignition temp. | 662 F |
| vapor density | 3.5 (vs air) |
| Assay | >=99% |
| vapor pressure | 6 mmHg ( 20 C) |
| refractive index | n20/D 1.452 (lit.) |
| bp | 140.4 C (lit.) |
Description
Acetylacetone, Reagentplus, >=99%